CymitQuimica logo

CAS 80028-44-0

:

ethyl pyrrolidine-3-carboxylate hydrochloride

Description:
Ethyl pyrrolidine-3-carboxylate hydrochloride is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features an ethyl ester functional group and a carboxylic acid moiety, contributing to its reactivity and solubility properties. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. Ethyl pyrrolidine-3-carboxylate hydrochloride is often utilized in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals due to its potential biological activity. The presence of the pyrrolidine ring may impart unique steric and electronic properties, making it a valuable intermediate in the synthesis of various bioactive compounds. Additionally, its hydrochloride form enhances its handling and storage characteristics, making it suitable for laboratory and industrial applications. Safety data should be consulted for proper handling, as with all chemical substances, to ensure safe usage in research and development contexts.
Formula:C7H14ClNO2
InChI:InChI=1/C7H13NO2.ClH/c1-2-10-7(9)6-3-4-8-5-6;/h6,8H,2-5H2,1H3;1H
InChI key:AYYKCALHTPKNOI-UHFFFAOYSA-N
SMILES:CCOC(=O)C1CCNC1.Cl
Synonyms:
  • Ethyl pyrrolidine-3-carboxylate hydrochloride (1:1)
  • Ethyl Pyrrolidine-3-Carboxylate Hcl
Found 4 products.