CAS 80040-79-5
:tri-O-benzyl-D-galactal
Description:
Tri-O-benzyl-D-galactal is a chemical compound characterized by the presence of three benzyl groups attached to the galactal structure, which is a derivative of galactose. This compound is typically used in organic synthesis and carbohydrate chemistry due to its ability to serve as a glycosyl donor or acceptor in various reactions. It is a white to off-white solid that is soluble in organic solvents such as dichloromethane and ethyl acetate, but generally insoluble in water. The presence of the benzyl groups enhances its stability and reactivity, making it useful in the synthesis of more complex carbohydrate structures. Additionally, tri-O-benzyl-D-galactal can undergo various chemical transformations, including deprotection and glycosylation reactions, which are essential in the development of glycosides and oligosaccharides. Its molecular structure and properties make it a valuable intermediate in the field of medicinal chemistry and the synthesis of biologically active compounds.
Formula:C27H28O4
InChI:InChI=1/C27H28O4/c1-4-10-22(11-5-1)18-28-21-26-27(31-20-24-14-8-3-9-15-24)25(16-17-29-26)30-19-23-12-6-2-7-13-23/h1-17,25-27H,18-21H2/t25-,26-,27-/m1/s1
SMILES:c1ccc(cc1)COC[C@@H]1[C@@H]([C@@H](C=CO1)OCc1ccccc1)OCc1ccccc1
Synonyms:- 3,4,6-Tri-O-benzyl-D-galactal
- 2,6-anhydro-1,3,4-tri-O-benzyl-5-deoxy-D-arabino-hex-5-enitol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3,4,6-Tri-O-benzyl-D-galactal
CAS:An important building block for solution- and solid-phase synthesis of oligosaccharides. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / iFormula:C27H28O4Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:416.51Tri-O-benzyl-D-galactal
CAS:Tri-O-benzyl-D-galactalFormula:C27H28O4Purity:98%Molecular weight:416.508823,4,6-Tri-O-benzyl-D-galactal
CAS:3,4,6-Tri-O-benzyl-D-galactal is a hydrogen bond donor and has been shown to have physiological activities. It was found to increase the number of lymphocytes in unimmunized mice. It also inhibits the growth of psoralea virus. The glycosidic bond between 3,4,6-tri-O-benzyl-D-galactal and glucose produces a product with an acetylated hydroxyl group and an aldehyde group. This type of bond is stereoselective and benzofuran derivatives are formed from the reaction. 3,4,6-Tri-O-benzyl-D-galactal has been shown to have anticancer activity against cancer cells in laboratory experiments.Formula:C27H28O4Purity:Min. 95%Color and Shape:White PowderMolecular weight:416.51 g/mol(2R,3R,4R)-3,4-Bis(benzyloxy)-2-((benzyloxy)methyl)-3,4-dihydro-2H-pyran
CAS:Purity:97%Molecular weight:416.5169983





