CAS 800402-12-4

2-chloro-5-iodo-pyridin-4-amine

Description:

2-Chloro-5-iodo-pyridin-4-amine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of both chlorine and iodine substituents at the 2 and 5 positions, respectively, contributes to its unique reactivity and potential applications in various fields, including medicinal chemistry and material science. This compound typically exhibits moderate solubility in polar organic solvents and may have limited solubility in water due to the hydrophobic nature of the halogen substituents. Its structure allows for potential interactions with biological targets, making it of interest in drug development. Additionally, the presence of the amino group at the 4-position enhances its reactivity, enabling further functionalization. The compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on the specific conditions and purity of the sample. Overall, 2-chloro-5-iodo-pyridin-4-amine is a versatile compound with significant implications in synthetic chemistry and pharmacology.

Formula: C₅H₄ClIN₂

InChI: InChI=1/C5H4ClIN2/c6-5-1-4(8)3(7)2-9-5/h1-2H,(H2,8,9)

SMILES: c1c(c(cnc1Cl)I)N

Synonyms:

• 2-Chloro-5-Iodopyridin-4-Amine
• 4-Pyridinamine, 2-chloro-5-iodo-

4-Amino-2-chloro-5-iodopyridine, 95%

CAS: 800402-12-4

This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci

Formula: C₅H₄ClIN₂

Purity: 95%

Color and Shape: Crystals or powder or crystalline powder, Cream

Molecular weight: 254.46

Ref: 02-H33926

2-Chloro-5-iodo-4-pyridinamine

CAS: 800402-12-4

Formula: C₅H₄ClIN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 254.4561

Ref: IN-DA0036HH

4-Amino-5-iodo-2-chloropyridine

CAS: 800402-12-4

4-Amino-5-iodo-2-chloropyridine

Purity: 98%

Color and Shape: Solid

Molecular weight: 254.45613g/mol

Ref: 54-OR303766

2-Chloro-5-iodo-4-pyridinamine

CAS: 800402-12-4

Formula: C₅H₄ClIN₂

Purity: 95%

Color and Shape: Solid, White to yellow or pale brown crystalline powder

Molecular weight: 254.46

Ref: 10-F217591