CAS 800402-12-4
:2-chloro-5-iodo-pyridin-4-amine
Description:
2-Chloro-5-iodo-pyridin-4-amine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of both chlorine and iodine substituents at the 2 and 5 positions, respectively, contributes to its unique reactivity and potential applications in various fields, including medicinal chemistry and material science. This compound typically exhibits moderate solubility in polar organic solvents and may have limited solubility in water due to the hydrophobic nature of the halogen substituents. Its structure allows for potential interactions with biological targets, making it of interest in drug development. Additionally, the presence of the amino group at the 4-position enhances its reactivity, enabling further functionalization. The compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on the specific conditions and purity of the sample. Overall, 2-chloro-5-iodo-pyridin-4-amine is a versatile compound with significant implications in synthetic chemistry and pharmacology.
Formula:C5H4ClIN2
InChI:InChI=1/C5H4ClIN2/c6-5-1-4(8)3(7)2-9-5/h1-2H,(H2,8,9)
SMILES:c1c(c(cnc1Cl)I)N
Synonyms:- 2-Chloro-5-Iodopyridin-4-Amine
- 4-Pyridinamine, 2-chloro-5-iodo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Amino-2-chloro-5-iodopyridine, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C5H4ClIN2Purity:95%Color and Shape:Crystals or powder or crystalline powder, CreamMolecular weight:254.464-Amino-5-iodo-2-chloropyridine
CAS:4-Amino-5-iodo-2-chloropyridineFormula:C5H4ClIN2Purity:98%Color and Shape:SolidMolecular weight:254.456132-Chloro-5-iodo-4-pyridinamine
CAS:2-Chloro-5-iodo-4-pyridinamineFormula:C5H4ClIN2Purity:95%Molecular weight:254.462-Chloro-5-iodo-4-pyridinamine
CAS:Formula:C5H4ClIN2Purity:98%Color and Shape:SolidMolecular weight:254.4561Ref: IN-DA0036HH
500gTo inquire250mg25.00€1g28.00€5g43.00€10g55.00€25g99.00€50g155.00€100g198.00€250g651.00€2-Chloro-5-iodo-4-pyridinamine
CAS:Formula:C5H4ClIN2Purity:95%Color and Shape:Solid, White to yellow or pale brown crystalline powderMolecular weight:254.46




