CAS 80049-85-0
:L-Prolinamide, N-(3-carboxy-1-oxopropyl)glycyl-N-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)-
Description:
L-Prolinamide, N-(3-carboxy-1-oxopropyl)glycyl-N-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)-, identified by the CAS number 80049-85-0, is a complex organic compound characterized by its unique structural features. This substance contains an amide functional group, which is indicative of its potential for forming hydrogen bonds, contributing to its solubility and reactivity. The presence of a carboxylic acid moiety suggests acidic properties, while the benzopyran ring indicates potential for aromatic interactions and biological activity. The compound's structure includes multiple functional groups, which may enhance its reactivity and ability to participate in various chemical reactions, including those relevant in medicinal chemistry. Additionally, the presence of a proline derivative suggests potential applications in peptide synthesis or as a chiral building block in organic synthesis. Overall, this compound's diverse functional groups and structural complexity may render it of interest in pharmaceutical research and development, particularly in the design of bioactive molecules.
Formula:C21H23N3O7
InChI:InChI=1S/C21H23N3O7/c1-12-9-20(29)31-16-10-13(4-5-14(12)16)23-21(30)15-3-2-8-24(15)18(26)11-22-17(25)6-7-19(27)28/h4-5,9-10,15H,2-3,6-8,11H2,1H3,(H,22,25)(H,23,30)(H,27,28)/t15-/m0/s1
InChI key:InChIKey=NKEPCOOQNLGSLJ-HNNXBMFYSA-N
SMILES:CC=1C=2C(=CC(NC(=O)[C@H]3N(C(CNC(CCC(O)=O)=O)=O)CCC3)=CC2)OC(=O)C1
Synonyms:- 4-{(aminoacetyl)[1-(4-methyl-2-oxo-2H-chromen-7-yl)-L-prolyl]amino}-4-oxobutanoic acid
- <span class="text-smallcaps">L</span>-Prolinamide, N-(3-carboxy-1-oxopropyl)glycyl-N-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)-
- Suc-Gly-Pro-AMC
- 1198: PN: WO2023172654 SEQID: 1206 claimed sequence
- L-Prolinamide, N-(3-carboxy-1-oxopropyl)glycyl-N-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)-
- 527: PN: US20220178935 SEQID: 1206 claimed sequence
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Suc-Gly-Pro-AMC
CAS:Suc-Gly-Pro-AMC, a fibroblast activation protein (FAP)-specific substrate, facilitates the examination of FAP activity [1].Formula:C21H23N3O7Color and Shape:SolidMolecular weight:429.42Suc-Gly-Pro-AMC
CAS:Suc-Gly-Pro-AMC is a research tool that is used to measure the activation of receptors. It binds to the receptor, which changes its conformation and leads to an ion channel opening. The change in ion concentration alters the voltage across the cell membrane, which can be measured. Suc-Gly-Pro-AMC has been shown to inhibit peptide binding to cells that are sensitive to the peptides, such as those with autoimmune diseases.Formula:C21H23N3O7Purity:Min. 95%Molecular weight:429.42 g/molSuc-Gly-Pro-AMC
CAS:AMC-conjugated molecule targeting the fibroblast activation protein (FAP)
Formula:C21H23N3O7Purity:Min. 95%Molecular weight:429.42 g/molSuc-Gly-Pro-AMC
CAS:The highly sensitive, fluorogenic substrate Suc-GP-AMC is suitable for the determination of prolyl endopeptidase (postproline cleaving enzyme) activity.Formula:C21H23N3O7Purity:95.2%Color and Shape:White PowderMolecular weight:429.43


