CymitQuimica logo

CAS 80258-94-2

:

(2,5-dioxoimidazolidin-1-yl)acetate

Description:
(2,5-Dioxoimidazolidin-1-yl)acetate, with the CAS number 80258-94-2, is a chemical compound characterized by its imidazolidine ring structure, which features two carbonyl groups (dioxo) and an acetate functional group. This compound typically exhibits properties associated with both heterocycles and esters, including potential reactivity due to the presence of the carbonyl groups, which can participate in various chemical reactions such as nucleophilic attacks. The imidazolidine ring contributes to its stability and may influence its solubility in polar solvents. Additionally, the acetate moiety can enhance its reactivity, making it a useful intermediate in organic synthesis. The compound may also exhibit biological activity, which could be of interest in pharmaceutical applications. Overall, (2,5-dioxoimidazolidin-1-yl)acetate is notable for its structural features that allow for diverse chemical behavior and potential utility in various chemical and biological contexts.
Formula:C5H5N2O4
InChI:InChI=1/C5H6N2O4/c8-3-1-6-5(11)7(3)2-4(9)10/h1-2H2,(H,6,11)(H,9,10)/p-1
InChI key:UYBPMPGSEWRTLG-UHFFFAOYSA-N
SMILES:C1C(=O)N(CC(=O)[O-])C(=N1)O
Found 3 products.