CymitQuimica logo

CAS 80307-12-6

:

N-succinimidyl 4-maleimidobutyrate

Description:
N-succinimidyl 4-maleimidobutyrate (SMBP) is a chemical compound commonly used in bioconjugation and protein labeling applications. It features a succinimidyl ester functional group, which is reactive towards amine groups, allowing for the formation of stable amide bonds with proteins or other biomolecules. The maleimide group in SMBP is particularly significant as it can selectively react with thiol groups, facilitating the formation of thioether linkages. This dual reactivity makes SMBP a versatile tool in the field of biochemistry and molecular biology, enabling researchers to create targeted conjugates for various applications, including drug delivery, diagnostics, and the development of biosensors. SMBP is typically supplied as a solid and should be handled with care, as it can be sensitive to moisture and light. Its stability and reactivity under physiological conditions make it a valuable reagent for studying protein interactions and modifications. Proper storage and handling are essential to maintain its integrity and effectiveness in experimental protocols.
Formula:C12H12N2O6
InChI:InChI=1/C12H12N2O6/c15-8-3-4-9(16)13(8)7-1-2-12(19)20-14-10(17)5-6-11(14)18/h3-4H,1-2,5-7H2
InChI key:PVGATNRYUYNBHO-UHFFFAOYSA-N
SMILES:C(CC(=O)ON1C(=O)CCC1=O)CN1C(=O)C=CC1=O
Found 11 products.