CAS 80321-63-7
:Gypenoside IX
Description:
Gypenoside IX is a saponin compound primarily derived from the plant species *Gynostemma pentaphyllum*, commonly known as jiaogulan. It is characterized by its complex glycosidic structure, which typically includes a steroid-like aglycone linked to sugar moieties. Gypenoside IX is known for its potential pharmacological properties, including antioxidant, anti-inflammatory, and immunomodulatory effects. It has been studied for its possible benefits in enhancing cardiovascular health, improving metabolic functions, and exhibiting adaptogenic properties, which may help the body cope with stress. The compound is often investigated in the context of traditional medicine and modern therapeutic applications. Its solubility and stability can vary depending on the formulation and conditions, making it a subject of interest in both natural product chemistry and pharmaceutical development. As with many bioactive compounds, further research is necessary to fully elucidate its mechanisms of action and therapeutic potential.
Formula:C47H80O17
InChI:InChI=1S/C47H80O17/c1-22(2)10-9-14-47(8,64-42-39(58)36(55)34(53)27(62-42)21-60-40-37(56)32(51)25(50)20-59-40)23-11-16-46(7)31(23)24(49)18-29-44(5)15-13-30(43(3,4)28(44)12-17-45(29,46)6)63-41-38(57)35(54)33(52)26(19-48)61-41/h10,23-42,48-58H,9,11-21H2,1-8H3/t23-,24+,25+,26+,27+,28-,29+,30-,31-,32-,33+,34+,35-,36-,37+,38+,39+,40-,41-,42-,44-,45+,46+,47-/m0/s1
InChI key:InChIKey=ZTQSADJAYQOCDD-HUGMCNGHSA-N
SMILES:C[C@]12[C@@]3(C)[C@@]([C@@]([C@@](O[C@@H]4O[C@H](CO[C@H]5[C@H](O)[C@@H](O)[C@H](O)CO5)[C@@H](O)[C@H](O)[C@H]4O)(CCC=C(C)C)C)(CC3)[H])([C@H](O)C[C@@]1([C@]6(C)[C@@](CC2)(C(C)(C)[C@@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)CC6)[H])[H])[H]
Synonyms:- Gypenoside IX
- β-D-Glucopyranoside, (3β,12β)-3-(β-D-glucopyranosyloxy)-12-hydroxydammar-24-en-20-yl 6-O-β-D-xylopyranosyl-
- (3β,12β)-3-(β-D-Glucopyranosyloxy)-12-hydroxydammar-24-en-20-yl 6-O-β-D-xylopyranosyl-β-D-glucopyranoside
- Dammarane, β-D-glucopyranoside deriv.
- Gynosaponin I
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Gypenoside IX
CAS:Gypenosides (Gyp, Stevenleaf) are triterpenoid saponins contained in an extract from Gynostemma pentaphyllum Makino, they induce apoptosis in human hepatoma cells through the up-regulation of Bax and Bak, and down-regulation of Bcl-2, release of mitochondrial cytochrome c and activation of caspase cascade.Formula:C47H80O17Purity:95%~99%Color and Shape:White powderMolecular weight:917.14Gynostemma Extract
CAS:Gynostemma Extract (Gypenoside IX) is a saponins extract derived from the Gynostemma pentaphyllum.Formula:C47H80O17Purity:98% - 99.6%Color and Shape:SolidMolecular weight:917.13Gypenoside IX
CAS:Gypenoside IX is a saponin compound, which is extracted from the Gynostemma pentaphyllum plant. This source is a perennial climbing herb known for its extensive use in traditional medicine throughout Asia. The mode of action of Gypenoside IX involves modulation of various signaling pathways, such as AMPK and PI3K/Akt, which play significant roles in cellular energy homeostasis and apoptotic processes.
Purity:Min. 95%






