CAS 80321-69-3: Gypenoside XVII
Description:Gypenoside XVII is a saponin compound primarily derived from the plant species *Gynostemma pentaphyllum*, commonly known as jiaogulan. It is characterized by its complex glycosidic structure, which typically includes a steroid-like aglycone backbone attached to multiple sugar moieties. This compound is known for its potential health benefits, including antioxidant, anti-inflammatory, and immunomodulatory properties. Gypenoside XVII has been studied for its effects on various biological systems, including its potential to enhance endurance and reduce fatigue. Additionally, it may exhibit neuroprotective effects and has been investigated for its role in metabolic regulation. The compound is soluble in water and organic solvents, making it versatile for various applications in herbal medicine and dietary supplements. Its safety profile and efficacy are subjects of ongoing research, highlighting the need for further studies to fully understand its pharmacological potential and mechanisms of action.
Formula:C48H82O18
InChI:InChI=1S/C48H82O18/c1-22(2)10-9-14-48(8,66-43-40(60)37(57)34(54)27(64-43)21-61-41-38(58)35(55)32(52)25(19-49)62-41)23-11-16-47(7)31(23)24(51)18-29-45(5)15-13-30(44(3,4)28(45)12-17-46(29,47)6)65-42-39(59)36(56)33(53)26(20-50)63-42/h10,23-43,49-60H,9,11-21H2,1-8H3/t23-,24+,25+,26+,27+,28-,29+,30-,31-,32+,33+,34+,35-,36-,37-,38+,39+,40+,41+,42-,43-,45-,46+,47+,48-/m0/s1
InChI key:InChIKey=ZRBFCAALKKNCJG-SJYBZOGZSA-N
SMILES:OCC1OC(OCC2OC(OC(C)(CCC=C(C)C)C3CCC4(C)C3C(O)CC5C6(C)CCC(OC7OC(CO)C(O)C(O)C7O)C(C)(C)C6CCC54C)C(O)C(O)C2O)C(O)C(O)C1O
- Synonyms:
- Gypenoside XVII
- β-D-Glucopyranoside, (3β,12β)-3-(β-D-glucopyranosyloxy)-12-hydroxydammar-24-en-20-yl 6-O-β-D-glucopyranosyl-
- Dammarane, β-D-glucopyranoside deriv.
- (3β,12β)-3-(β-D-Glucopyranosyloxy)-12-hydroxydammar-24-en-20-yl 6-O-β-D-glucopyranosyl-β-D-glucopyranoside
- Gynosaponin S
