CAS 80321-69-3
:Gypenoside XVII
Description:
Gypenoside XVII is a saponin compound primarily derived from the plant species *Gynostemma pentaphyllum*, commonly known as jiaogulan. It is characterized by its complex glycosidic structure, which typically includes a steroid-like aglycone backbone attached to multiple sugar moieties. This compound is known for its potential health benefits, including antioxidant, anti-inflammatory, and immunomodulatory properties. Gypenoside XVII has been studied for its effects on various biological systems, including its potential to enhance endurance and reduce fatigue. Additionally, it may exhibit neuroprotective effects and has been investigated for its role in metabolic regulation. The compound is soluble in water and organic solvents, making it versatile for various applications in herbal medicine and dietary supplements. Its safety profile and efficacy are subjects of ongoing research, highlighting the need for further studies to fully understand its pharmacological potential and mechanisms of action.
Formula:C48H82O18
InChI:InChI=1S/C48H82O18/c1-22(2)10-9-14-48(8,66-43-40(60)37(57)34(54)27(64-43)21-61-41-38(58)35(55)32(52)25(19-49)62-41)23-11-16-47(7)31(23)24(51)18-29-45(5)15-13-30(44(3,4)28(45)12-17-46(29,47)6)65-42-39(59)36(56)33(53)26(20-50)63-42/h10,23-43,49-60H,9,11-21H2,1-8H3/t23-,24+,25+,26+,27+,28-,29+,30-,31-,32+,33+,34+,35-,36-,37-,38+,39+,40+,41+,42-,43-,45-,46+,47+,48-/m0/s1
InChI key:InChIKey=ZRBFCAALKKNCJG-SJYBZOGZSA-N
SMILES:C[C@]12[C@@]3(C)[C@@]([C@@]([C@@](O[C@@H]4O[C@H](CO[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@H]4O)(CCC=C(C)C)C)(CC3)[H])([C@H](O)C[C@@]1([C@]6(C)[C@@](CC2)(C(C)(C)[C@@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)CC6)[H])[H])[H]
Synonyms:- Gypenoside XVII
- β-D-Glucopyranoside, (3β,12β)-3-(β-D-glucopyranosyloxy)-12-hydroxydammar-24-en-20-yl 6-O-β-D-glucopyranosyl-
- Dammarane, β-D-glucopyranoside deriv.
- (3β,12β)-3-(β-D-Glucopyranosyloxy)-12-hydroxydammar-24-en-20-yl 6-O-β-D-glucopyranosyl-β-D-glucopyranoside
- Gynosaponin S
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Gypenoside XVII
CAS:Gypenoside XVII analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C48H82O18Purity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:947.17Gypenoside XVII
CAS:Gypenoside XVII (Gynosaponin S) confers protection against Aβ25-35-induced neurotoxicity through estrogen receptor-dependent activation of PI3K/Akt pathways,Formula:C48H82O18Purity:98% - 99.89%Color and Shape:SolidMolecular weight:947.15Gypenoside XVII
CAS:Natural glycosideFormula:C48H82O18Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:947.17Gypenoside XVII
CAS:Gypenoside XVII is a bioactive compound, which is a saponin derived from the plant Gynostemma pentaphyllum, commonly known as Jiaogulan. This compound is part of a broader category of plant-derived triterpenoid saponins that exhibit diverse biological activities. Gypenoside XVII functions primarily through its modulation of signaling pathways, including antioxidant, anti-inflammatory, and metabolic regulatory mechanisms. It affects key molecular targets and pathways, such as AMPK activation and nitric oxide production, offering potential therapeutic benefits.Formula:C48H82O18Purity:Min. 95%Color and Shape:PowderMolecular weight:947.15 g/molGypenoside XVII
CAS:Controlled ProductStability Hygroscopic
Applications Gypenoside XVII is a major saponin abundant in ginseng and Panax notoginseng which ameliorated amyloid-(Aβ)25-35-induced apoptosis in PC12 cells by regulating autophagy.
References Meng, X., et al.: J. Alzheimer Dis., 52, 1135-1150 (2016)Formula:C48H82O18Color and Shape:NeatMolecular weight:947.15








