CymitQuimica logo

CAS 80353-95-3

:

5,7-Dimethylimidazo[1,2-a]pyridine-2-carboxylic acid

Description:
5,7-Dimethylimidazo[1,2-a]pyridine-2-carboxylic acid is a heterocyclic organic compound characterized by its fused imidazo and pyridine rings, which contribute to its aromatic properties. This compound features two methyl groups at the 5 and 7 positions of the imidazo ring and a carboxylic acid functional group at the 2 position of the pyridine ring. It is known for its potential role as a mutagen and carcinogen, often studied in the context of food safety and toxicology, particularly due to its formation during the cooking of certain meats at high temperatures. The presence of the carboxylic acid group enhances its solubility in polar solvents, while the aromatic structure contributes to its stability and reactivity. This compound is of interest in research related to cancer biology and the mechanisms of chemical carcinogenesis. Its CAS number, 80353-95-3, is used for identification in chemical databases and regulatory contexts.
Formula:C10H10N2O2
InChI:InChI=1S/C10H10N2O2/c1-6-3-7(2)12-5-8(10(13)14)11-9(12)4-6/h3-5H,1-2H3,(H,13,14)
InChI key:InChIKey=RJHQZHBSMYPWAI-UHFFFAOYSA-N
SMILES:CC=1N2C(=NC(C(O)=O)=C2)C=C(C)C1
Synonyms:
  • Imidazo[1,2-a]pyridine-2-carboxylic acid, 5,7-dimethyl-
  • 5,7-Dimethylimidazo[1,2-a]pyridine-2-carboxylic acid
Found 2 products.