CAS 80404-14-4

4-oxo-tempo-D16-15N

Description:

4-Oxo-tempo-D16-15N, with the CAS number 80404-14-4, is a stable nitroxide radical that is often used in various fields such as organic chemistry, biochemistry, and materials science. This compound features a nitroxide functional group, which is characterized by the presence of an oxygen atom bonded to a nitrogen atom with an unpaired electron, imparting unique radical properties. The "D16" designation indicates that the compound contains deuterium, a stable isotope of hydrogen, which can be useful in NMR spectroscopy and tracing studies. The "15N" label signifies the incorporation of the nitrogen-15 isotope, allowing for enhanced analytical techniques. 4-Oxo-tempo-D16-15N is known for its stability under a variety of conditions, making it a valuable tool in studying reaction mechanisms, electron transfer processes, and as a spin label in electron paramagnetic resonance (EPR) spectroscopy. Its unique isotopic composition also aids in distinguishing it from other similar compounds in complex mixtures.

Formula: C9H16NO2

InChI: InChI=1S/C9H16NO2/c1-8(2)5-7(11)6-9(3,4)10(8)12/h5-6H2,1-4H3/i10+1

InChI key: WSGDRFHJFJRSFY-DETAZLGJSA-N

SMILES: CC1(CC(=O)CC([15N]1[O])(C)C)C

4-Oxo-2,2,6,6-tetramethyl-piperidine-d16;1-15N-1-oxyl"Carboglace"

CAS: 2896-70-0, 80404-14-4

Purity: 98 atom % D; 99 atom % 15N

Color and Shape: Pink Solid

Molecular weight: 187.34

Ref: 3U-M2327

4-Oxo-2,2,6,6-tetramethylpiperidine-d16;1-15N-1-oxyl

Controlled Product

CAS: 80404-14-4

Applications 4-Oxo-2,2,6,6-tetramethylpiperidine-d16;1-15N-1-oxyl (CAS# 80404-14-4) is a useful isotopically labeled research compound.

Formula: C₉₂H₁₆₁₅NO₂

Color and Shape: Neat

Molecular weight: 187.32

Ref: TR-O864002