CAS 80410-57-7
:Benzaldehyde,3-methoxy-4-nitro-
Description:
Benzaldehyde, 3-methoxy-4-nitro- is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with a methoxy group (-OCH₃) and a nitro group (-NO₂) at the 3 and 4 positions, respectively. This compound is typically a yellow to brown solid or liquid, depending on its purity and specific conditions. It has a distinct aromatic odor, reminiscent of almonds, due to the presence of the benzaldehyde moiety. The methoxy group contributes to its electron-donating properties, while the nitro group is an electron-withdrawing substituent, influencing the compound's reactivity and polarity. Benzaldehyde derivatives are often used in organic synthesis, serving as intermediates in the production of various pharmaceuticals, agrochemicals, and fragrances. Additionally, the presence of both electron-donating and electron-withdrawing groups can affect the compound's chemical behavior, making it a subject of interest in studies related to reactivity and substitution patterns in aromatic compounds. Safety precautions should be taken when handling this substance, as it may pose health risks upon exposure.
Formula:C8H7NO4
InChI:InChI=1S/C8H7NO4/c1-13-8-4-6(5-10)2-3-7(8)9(11)12/h2-5H,1H3
InChI key:WUTIWOZYHHSBBU-UHFFFAOYSA-N
SMILES:COC1=C(C=CC(=C1)C=O)[N+](=O)[O-]
Synonyms:- 3-Methoxy-4-nitrobenzaldehyde
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3-Methoxy-4-nitrobenzaldehyde
CAS:3-Methoxy-4-nitrobenzaldehydeFormula:C8H7NO4Purity:97%Color and Shape:Pale orange Solid-CrystalsMolecular weight:181.145483-Methoxy-4-nitrobenzaldehyde
CAS:Formula:C8H7NO4Purity:95%Color and Shape:SolidMolecular weight:181.14553-Methoxy-4-nitrobenzaldehyde
CAS:3-Methoxy-4-nitrobenzaldehydeFormula:C8H7NO4Purity:95%Molecular weight:181.153-Methoxy-4-nitrobenzaldehyde
CAS:Formula:C8H7NO4Purity:95%Color and Shape:LiquidMolecular weight:181.1473-methoxy-4-nitrobenzaldehyde
CAS:3-Methoxy-4-nitrobenzaldehyde (3MNB) is a biomolecular that is used to study nucleophilic substitutions. It has been shown to inhibit the growth of cells in culture, specifically those with fatty acid amides. 3MNB inhibits the synthesis of β-amyloid, a protein associated with Alzheimer's disease. 3MNB also has potent inhibitory activity on chloride channels and phenylhydrazone binding sites, which are targets for antipsychotic drugs. 3MNB inhibits the production of sh-sy5y cells and piperazine binding sites in the brain. The inhibition of these sites leads to an improvement in memory and learning ability.
Formula:C8H7NO4Purity:Min. 95%Molecular weight:181.1 g/molRef: 3D-FDA41057
Discontinued product




