CAS 80508-81-2
:(7α,14R)-14-(Acetyloxy)-7-hydroxykaur-16-ene-3,15-dione
Description:
The chemical substance known as "(7α,14R)-14-(Acetyloxy)-7-hydroxykaur-16-ene-3,15-dione," with the CAS number 80508-81-2, is a naturally occurring compound belonging to the kaurene family, which is characterized by a tetracyclic structure. This compound features multiple functional groups, including hydroxyl and acetoxy moieties, contributing to its reactivity and potential biological activity. The presence of the dione functional groups indicates that it may participate in various chemical reactions, such as oxidation and reduction. Its stereochemistry, denoted by the specific configuration at the 7α and 14R positions, suggests that it may exhibit specific interactions with biological targets, potentially influencing its pharmacological properties. Compounds of this nature are often studied for their roles in plant physiology and their potential therapeutic applications, including anti-inflammatory and anticancer activities. Overall, the unique structural features of this compound make it a subject of interest in both organic chemistry and medicinal research.
Formula:C22H30O5
InChI:InChI=1S/C22H30O5/c1-11-13-6-7-14-21(5)9-8-16(24)20(3,4)15(21)10-17(25)22(14,18(11)26)19(13)27-12(2)23/h13-15,17,19,25H,1,6-10H2,2-5H3/t13-,14-,15+,17+,19+,21-,22-/m0/s1
InChI key:InChIKey=LSUXOKVMORWDLT-KEXKRWMXSA-N
SMILES:O(C(C)=O)[C@H]1[C@@]23[C@]([C@@]4(C)[C@](C[C@H]2O)(C(C)(C)C(=O)CC4)[H])(CC[C@]1(C(=C)C3=O)[H])[H]
Synonyms:- (7α,14R)-14-(Acetyloxy)-7-hydroxykaur-16-ene-3,15-dione
- 14β-Acetoxy-7α-hydroxy-ent-kaur-16-ene-3,15-dione
- Wangzaozin C
- Glaucocalyxin B
- Kaur-16-ene-3,15-dione, 14-(acetyloxy)-7-hydroxy-, (7α,14R)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Glaucocalyxin B
CAS:Glaucocalyxin B is a diterpenoid isolated from Rabdosia japonica with anticancer and antitumor activity. It decreases the growth of HL-60 cells (IC50: 5.86 μM).Formula:C22H30O5Purity:99.13% - 99.35%Color and Shape:SolidMolecular weight:374.47Glaucocalyxin B
CAS:Glaucocalyxin B is a potent anticancer agent that has been shown to have cytotoxic effects on cancer cells. It binds to the dinucleotide phosphate of the apoptosis pathway, inhibiting cell proliferation and inducing apoptosis. Glaucocalyxin B induces autophagy in cancer cells, which may be due to its calcium binding activity. Glaucocalyxin B also has potent anticancer effects against carcinoma cell lines. This compound has been shown to have similar effects on microglia and Toll-like receptors as other natural compounds such as resveratrol, genistein, and curcumin.
Formula:C22H30O5Purity:Min. 95%Molecular weight:374.47 g/molRef: 3D-FDA50881
Discontinued product




