CymitQuimica logo

CAS 80565-30-6

:

4'-Chlorobiphenyl-4-carbaldehyde

Description:
4'-Chlorobiphenyl-4-carbaldehyde, with the CAS number 80565-30-6, is an organic compound characterized by its biphenyl structure substituted with a chlorine atom and an aldehyde functional group. This compound features a biphenyl backbone, which consists of two phenyl rings connected by a single bond, enhancing its stability and hydrophobic properties. The presence of the chlorine atom introduces electronegativity, influencing the compound's reactivity and solubility in various solvents. The aldehyde group (-CHO) is a key functional group that can participate in various chemical reactions, such as nucleophilic additions and condensation reactions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of other chemical substances. Its physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Safety precautions should be observed when handling this compound, as it may pose health risks typical of chlorinated organic compounds.
Formula:C13H9ClO
InChI:InChI=1/C13H9ClO/c14-13-7-5-12(6-8-13)11-3-1-10(9-15)2-4-11/h1-9H
InChI key:UXCMNUUPBMYDLJ-UHFFFAOYSA-N
SMILES:c1cc(ccc1C=O)c1ccc(cc1)Cl
Synonyms:
  • 4'-Chloro-[1,1'-biphenyl]-4-carboxaldehyde
  • 4'-Chloro-biphenyl-4-carbaldehyde
Found 7 products.