CymitQuimica logo

CAS 80635-92-3

:

4-Methyl-2-(4-methylphenyl)pyridine

Description:
4-Methyl-2-(4-methylphenyl)pyridine, with the CAS number 80635-92-3, is an organic compound characterized by its pyridine ring structure substituted with both a methyl group and a para-methylphenyl group. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents, reflecting its non-polar characteristics due to the presence of aromatic groups. The presence of the pyridine nitrogen atom contributes to its basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Its molecular structure suggests potential applications in organic synthesis, pharmaceuticals, and as a ligand in coordination chemistry. Additionally, the compound may exhibit interesting electronic properties due to the conjugation between the aromatic systems, which can influence its reactivity and interactions with other molecules. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C13H13N
InChI:InChI=1S/C13H13N/c1-10-3-5-12(6-4-10)13-9-11(2)7-8-14-13/h3-9H,1-2H3
InChI key:InChIKey=ZOIHWNNIRAGRNZ-UHFFFAOYSA-N
SMILES:CC=1C=C(N=CC1)C2=CC=C(C)C=C2
Synonyms:
  • 2-(4-Methylphenyl)-4-methylpyridine
  • 4-Methyl-2-p-tolyl-pyridine
  • Pyridine, 4-Methyl-2-(4-Methylphenyl)-
  • 4-Methyl-2-(4-methylphenyl)pyridine
Found 5 products.