CymitQuimica logo

CAS 80663-92-9

:

Perylene, 2,5,8,11-tetrakis(1,1-dimethylethyl)-

Description:
Perylene, 2,5,8,11-tetrakis(1,1-dimethylethyl)-, with the CAS number 80663-92-9, is a polycyclic aromatic hydrocarbon characterized by its four tert-butyl substituents at the 2, 5, 8, and 11 positions of the perylene core structure. This compound exhibits a high degree of stability due to the steric hindrance provided by the bulky tert-butyl groups, which also enhance its solubility in organic solvents. Perylene derivatives are known for their strong fluorescence properties, making them useful in applications such as organic light-emitting diodes (OLEDs) and as fluorescent probes in various chemical and biological studies. The presence of the tert-butyl groups can also influence the electronic properties of the molecule, potentially enhancing its electron-donating capabilities. Additionally, this compound is typically non-polar and hydrophobic, which affects its interactions in biological systems and its environmental behavior. Overall, the unique structure and properties of this perylene derivative make it of interest in materials science and organic chemistry.
Formula:C36H44
InChI:InChI=1S/C36H44/c1-33(2,3)23-13-21-14-24(34(4,5)6)19-29-30-20-26(36(10,11)12)16-22-15-25(35(7,8)9)18-28(32(22)30)27(17-23)31(21)29/h13-20H,1-12H3
InChI key:BFTIPCRZWILUIY-UHFFFAOYSA-N
SMILES:CC(C)(C)C1=CC2=C3C(=C1)C=C(C=C3C4=CC(=CC5=CC(=CC2=C54)C(C)(C)C)C(C)(C)C)C(C)(C)C
Found 6 products.