CAS 80690-77-3
:L-phenylalanyl-L-leucyl-N~5~-(diaminomethylidene)-L-ornithyl-L-phenylalaninamide
Description:
L-phenylalanyl-L-leucyl-N~5~-(diaminomethylidene)-L-ornithyl-L-phenylalaninamide, with the CAS number 80690-77-3, is a synthetic peptide that exhibits characteristics typical of peptide compounds. It is composed of multiple amino acids, specifically phenylalanine, leucine, and ornithine, which contribute to its structural and functional properties. This compound is likely to exhibit biological activity, potentially influencing various physiological processes due to its peptide nature. Peptides like this one can serve as substrates or inhibitors in enzymatic reactions, and they may also interact with receptors, affecting signaling pathways. The presence of the diaminomethylidene group suggests potential for enhanced stability or bioactivity. Additionally, the molecular structure may confer specific solubility and reactivity characteristics, making it suitable for research in biochemistry or pharmacology. As with many peptides, its stability can be influenced by factors such as pH, temperature, and the presence of other ions or molecules in the environment.
Formula:C30H44N8O4
InChI:InChI=1/C30H44N8O4/c1-19(2)16-25(38-27(40)22(31)17-20-10-5-3-6-11-20)29(42)36-23(14-9-15-35-30(33)34)28(41)37-24(26(32)39)18-21-12-7-4-8-13-21/h3-8,10-13,19,22-25H,9,14-18,31H2,1-2H3,(H2,32,39)(H,36,42)(H,37,41)(H,38,40)(H4,33,34,35)/t22-,23-,24-,25-/m0/s1
SMILES:CC(C)C[C@@H](C(=N[C@@H](CCCNC(=N)N)C(=N[C@@H](Cc1ccccc1)C(=N)O)O)O)N=C([C@H](Cc1ccccc1)N)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
H-Phe-Leu-Arg-Phe-NH2 acetate salt
CAS:<p>H-Phe-Leu-Arg-Phe-NH2 acetate salt is a peptide that has been shown to inhibit neuronal activity in the Xenopus oocyte. This inhibition is biphasic and can be reversed by the addition of an excess of glutamate. It has been shown to have an inhibitory effect on the release of neurotransmitters from the isolated heart, ganglia, and subesophageal ganglion. The sequence of H-Phe-Leu-Arg-Phe-NH2 acetate salt has been determined as carboxy terminal. The physiological effects of H-Phe-Leu-Arg-Phe-NH2 acetate salt are related to its receptor binding properties.</p>Formula:C30H44N8O4Purity:Min. 95%Molecular weight:580.72 g/mol
