CAS 80755-87-9

lys-gln-ala-gly-asp-val

Description:

The chemical substance referred to as "lys-gln-ala-gly-asp-val" is a peptide composed of six amino acids: lysine (Lys), glutamine (Gln), alanine (Ala), glycine (Gly), aspartic acid (Asp), and valine (Val). Its CAS number, 80755-87-9, identifies this specific peptide in chemical databases. Peptides like this one are typically characterized by their sequence of amino acids, which determines their structure and function. They can exhibit various biological activities, including roles in signaling, metabolism, and cellular communication. The presence of both polar and non-polar amino acids in this sequence suggests potential solubility in aqueous environments, as well as interactions with lipid membranes. Additionally, the specific arrangement of these amino acids can influence the peptide's conformation, stability, and reactivity. Such peptides are often studied for their therapeutic potential, including their use in drug development and as biomarkers in various biological processes.

Formula: C₂₅H₄₄N₈O₁₀

InChI: InChI=1S/C25H44N8O10/c1-12(2)20(25(42)43)33-24(41)16(10-19(36)37)31-18(35)11-29-21(38)13(3)30-23(40)15(7-8-17(28)34)32-22(39)14(27)6-4-5-9-26/h12-16,20H,4-11,26-27H2,1-3H3,(H2,28,34)(H,29,38)(H,30,40)(H,31,35)(H,32,39)(H,33,41)(H,36,37)(H,42,43)

InChI key: AFAFFVKJJYBBTC-UHFFFAOYSA-N

SMILES: CC(C)C(C(=O)O)NC(=O)C(CC(=O)O)NC(=O)CNC(=O)C(C)NC(=O)C(CCC(=O)N)NC(=O)C(CCCCN)N

Synonyms:

• H-Lys-Gln-Ala-Gly-Asp-Val-OH

H-Lys-Gln-Ala-Gly-Asp-Val-OH

CAS: 80755-87-9

H-Lys-Gln-Ala-Gly-Asp-Val-OH

Formula: C₂₅H₄₄N₈O₁₀

Purity: 98%

Molecular weight: 616.66

Ref: 54-OR1162071

Lys-Gln-Ala-Gly-Asp-Val

CAS: 80755-87-9

KQAGDV is a fibrinogen γ-chain cell adhesion peptide, targeting α2bβ3 integrin, and binds SMCs.

Formula: C₂₅H₄₄N₈O₁₀

Color and Shape: Solid

Molecular weight: 616.66

Ref: TM-T76376

H-LYS-GLN-ALA-GLY-ASP-VAL-OH

CAS: 80755-87-9

Formula: C₂₅H₄₄N₈O₁₀

Purity: 98%

Molecular weight: 616.6645

Ref: IN-DA00G2N5

H-Lys-Gln-Ala-Gly-Asp-Val-OH

CAS: 80755-87-9

H-Lys-Gln-Ala-Gly-Asp-Val-OH is a synthetic peptide that is used as a research tool. It is synthesized by recombinant e. coli cells and has been shown to have strong affinity for the specific ligand, fluorescence and microbial assays. This synthetic peptide is hydrophilic and can be detected using confocal microscopy. It also exhibits biodegradability in an e. coli environment, which may be due to its lysine residue.

Formula: C₂₅H₄₄N₈O₁₀

Purity: Min. 95%

Molecular weight: 616.66 g/mol

Ref: 3D-FL108968