CymitQuimica logo

CAS 80862-08-4

:

6-methoxy-1H-pyrrolo[3,2-c]pyridine

Description:
6-Methoxy-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its pyrrole and pyridine ring structures, which contribute to its unique chemical properties. This compound features a methoxy group (-OCH3) at the 6-position of the pyrrolo ring, enhancing its solubility and reactivity. It is typically a solid at room temperature and exhibits moderate stability under standard conditions. The presence of both nitrogen atoms in the ring system imparts basicity and potential for coordination with metal ions, making it of interest in coordination chemistry and medicinal chemistry. Its structural features may also influence its biological activity, potentially serving as a scaffold for drug development. The compound is often synthesized through multi-step organic reactions, and its derivatives may exhibit various pharmacological properties, including neuroprotective and anti-inflammatory effects. As with many heterocycles, it may also participate in diverse chemical reactions, such as electrophilic substitutions or nucleophilic attacks, depending on the functional groups present.
Formula:C8H8N2O
InChI:InChI=1/C8H8N2O/c1-11-8-4-7-6(5-10-8)2-3-9-7/h2-5,9H,1H3
InChI key:NJYHZMQGTQOAJJ-UHFFFAOYSA-N
SMILES:COc1cc2c(cc[nH]2)cn1
Found 4 products.