CAS 81-54-9: Purpurin
Description:Purpurin, with the CAS number 81-54-9, is an organic compound belonging to the class of anthraquinones, which are characterized by their aromatic structure and extensive conjugation. It is a red dye that is primarily derived from the madder plant, historically used in textiles. Purpurin exhibits a strong absorption in the visible spectrum, contributing to its vibrant color, and is known for its ability to form complexes with metal ions, which can enhance its color stability and application in various fields. The compound is soluble in organic solvents but has limited solubility in water. Purpurin has been studied for its potential applications in dye-sensitized solar cells, as well as in biochemistry for its fluorescent properties. Additionally, it has shown some biological activity, including antimicrobial properties. However, like many organic dyes, its environmental impact and stability under light exposure are important considerations in its use. Overall, purpurin is a significant compound in both historical and modern contexts, particularly in dye chemistry and materials science.
Formula:C14H8O5
InChI:InChI=1S/C14H8O5/c15-8-5-9(16)14(19)11-10(8)12(17)6-3-1-2-4-7(6)13(11)18/h1-5,15-16,19H
InChI key:InChIKey=BBNQQADTFFCFGB-UHFFFAOYSA-N
SMILES:O=C1C=2C=CC=CC2C(=O)C=3C(O)=C(O)C=C(O)C13
- Synonyms:
- 1,2,4-Trihydroxy-9,10-anthracenedione
- Purpurin
- Anthraquinone, 1,2,4-trihydroxy-
- C.I. 58205
- 9,10-Anthracenedione, 1,2,4-trihydroxy-
