CymitQuimica logo

CAS 81190-28-5

:

3-(perfluoro-N-butyl)1,2-propenoxide

Description:
3-(Perfluoro-N-butyl)1,2-propenoxide is a fluorinated organic compound characterized by the presence of a propenoxide functional group and a perfluorinated butyl chain. This compound typically exhibits unique properties due to the influence of the perfluorinated moiety, which imparts hydrophobicity and chemical stability. The presence of the propenoxide group suggests potential reactivity, particularly in polymerization or cross-linking reactions, making it useful in various applications, including coatings and surfactants. The perfluorinated chain enhances the compound's resistance to heat, chemicals, and biological degradation, contributing to its utility in specialized industrial applications. Additionally, the compound may exhibit low surface tension and high surface activity, which can be advantageous in formulations requiring wetting or spreading properties. Safety and environmental considerations are important, as perfluorinated compounds can have persistent environmental effects. Overall, 3-(perfluoro-N-butyl)1,2-propenoxide is notable for its unique combination of reactivity and stability, making it a subject of interest in both research and industrial contexts.
Formula:C7H5F9O
InChI:InChI=1/C7H5F9O/c8-4(9,1-3-2-17-3)5(10,11)6(12,13)7(14,15)16/h3H,1-2H2
InChI key:WUKHWLIEBSRTRH-UHFFFAOYSA-N
SMILES:C(C1CO1)C(C(C(C(F)(F)F)(F)F)(F)F)(F)F
Synonyms:
  • (2,2,3,3,4,4,5,5,5-Nonafluoropentyl)oxirane
  • 3-(Nonafluoro-n-butyl)-1,2-propenoxide
  • 2-(2,2,3,3,4,4,5,5,5-Nonafluoropentyl)Oxirane
Found 4 products.