CAS 813-56-9
:Propanedioic-2,2-d2 acid-1,3-d2
Description:
Propanedioic-2,2-d2 acid-1,3-d2, also known as deuterated malonic acid, is a deuterated derivative of malonic acid, which is a dicarboxylic acid with the molecular formula C3H4O4. The presence of deuterium (D) in place of hydrogen (H) in its structure gives it unique properties, particularly in nuclear magnetic resonance (NMR) spectroscopy, where it can be used as a tracer or in studies involving isotopic labeling. This compound typically appears as a white crystalline solid and is soluble in water and various organic solvents. Its deuterated nature can enhance the stability and reactivity of certain chemical reactions, making it valuable in synthetic organic chemistry and biochemical research. Additionally, the presence of two carboxylic acid groups contributes to its acidity and reactivity, allowing it to participate in various chemical transformations. As with many deuterated compounds, it is used in research applications, particularly in studies involving metabolic pathways and reaction mechanisms.
Formula:C3D4O4
InChI:InChI=1S/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7)/i1D2/hD2
InChI key:InChIKey=OFOBLEOULBTSOW-BGOGGDMHSA-N
SMILES:C(C(O[2H])=O)(C(O[2H])=O)([2H])[2H]
Synonyms:- (~2~H_2_)propane(~2~H_2_)dioic acid
- Malonic acid-d4
- Malonic acid-d<sub>4</sub>
- Malonic-d<sub>2</sub> acid-d<sub>2</sub>
- Propanedioic-2,2-d<sub>2</sub> acid-1,3-d<sub>2</sub>
- Propanedioic-d<sub>2</sub> acid-d<sub>2</sub>
- Tetradeuteriomalonic acid
- Malonic-d2 acid-d2
- Propanedioic-2,2-d2 acid-1,3-d2
- Propanedioic-d2 acid-d2
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Malonic Acid-D4 >99.5 Atom % D 10g bottle
CAS:Malonic Acid-D4 >99.5 Atom % D 10g bottle
Purity:>99.5 Atom % DColor and Shape:SolidMolecular weight:108.09g/molMalonic Acid-d4
CAS:Controlled ProductStability Moisture Sensitive
Applications Malonic Acid-d4 is the isotope labelled analog of Malonic Acid (M158005); a small bioactive molecule that can be used in various reactions. It is the classic example of a competitive inhibitor which acts against succinate dehydrogenase (complex II) in the respiratory electron transport chain.
References Weiner, N., "Malonic Acid", Org. Synth.; Coll. Vol. 2: 376Formula:C3D4O4Color and Shape:NeatMolecular weight:108.086

