CAS 81382-45-8
:1H-Indazol-4-ol
Description:
1H-Indazol-4-ol, with the CAS number 81382-45-8, is an organic compound characterized by its indazole core, which consists of a five-membered ring containing two nitrogen atoms. This compound features a hydroxyl (-OH) group at the 4-position of the indazole ring, contributing to its chemical reactivity and potential biological activity. 1H-Indazol-4-ol is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydroxyl group. Its structure allows for hydrogen bonding, which can influence its interactions in various chemical environments. This compound is of interest in medicinal chemistry and research due to its potential pharmacological properties, including anti-inflammatory and anticancer activities. Additionally, it may serve as a building block in the synthesis of more complex molecules. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C7H6N2O
InChI:InChI=1/C7H6N2O/c10-7-3-1-2-6-5(7)4-8-9-6/h1-4,10H,(H,8,9)
SMILES:c1cc2c(c[nH]n2)c(c1)O
Synonyms:- 4-Hydroxyindazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Hydroxy-1H-indazole
CAS:4-Hydroxy-1H-indazoleFormula:C7H6N2OPurity:≥95%Color and Shape:SolidMolecular weight:134.135331H-Indazol-4-ol
CAS:1H-Indazol-4-ol is a synthetic chemical with the molecular formula CHNO. It is the chloride, nitro, diammonium, enamine, divalent, methyl ester, acrylonitrile, polyethylene terephthalate and anion form of 1H-indazole. 1H-Indazol-4-ol is used in the synthesis of aminonaphthalenes and triazoles. The polymerization reaction for the production of cellulose acetate is also catalyzed by 1H-indazole. This chemical has been shown to have anion properties in solvents such as water and alcohols.Formula:C7H6N2OPurity:Min. 95%Molecular weight:134.14 g/mol




