CymitQuimica logo

CAS 81403-67-0

:

Tetrahydro-N-[3-(methylamino)propyl]-2-furancarboxamide

Description:
Tetrahydro-N-[3-(methylamino)propyl]-2-furancarboxamide, identified by its CAS number 81403-67-0, is a chemical compound characterized by its unique structure, which includes a furan ring and an amide functional group. This compound features a tetrahydrofuran moiety, indicating it is a saturated derivative of furan, contributing to its stability and solubility in organic solvents. The presence of a methylamino group suggests potential biological activity, as amines often play crucial roles in pharmacology and biochemistry. The compound's molecular structure allows for various interactions, including hydrogen bonding, which can influence its reactivity and solubility in different environments. While specific physical properties such as melting point, boiling point, and solubility may vary, compounds of this nature are typically studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. As with any chemical substance, safety data and handling precautions should be observed, especially considering its potential biological activity.
Formula:C9H18N2O2
InChI:InChI=1S/C9H18N2O2/c1-10-5-3-6-11-9(12)8-4-2-7-13-8/h8,10H,2-7H2,1H3,(H,11,12)
InChI key:InChIKey=AUXJTEANWWFSRR-UHFFFAOYSA-N
SMILES:C(NCCCNC)(=O)C1CCCO1
Synonyms:
  • 2-Furancarboxamide, tetrahydro-N-[3-(methylamino)propyl]-
  • N-[3-(methylamino)propyl]tetrahydrofuran-2-carboxamide
  • Tetrahydro-N-[3-(methylamino)propyl]-2-furancarboxamide
  • Tetrahydro-N-[3-(methylamino)propyl]furan-2-carboxamide
Found 2 products.