CymitQuimica logo

CAS 81448-48-8

:

ethyl 2,7-dimethy-lH-imidazo[1,2-a]pyridine-3-carboxylate

Description:
Ethyl 2,7-dimethyl-1H-imidazo[1,2-a]pyridine-3-carboxylate is a chemical compound characterized by its imidazo-pyridine structure, which incorporates both a pyridine and an imidazole ring. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of two methyl groups at the 2 and 7 positions of the imidazo ring influences its steric and electronic properties, potentially affecting its biological activity and interactions. Typically, compounds of this class may exhibit various pharmacological activities, making them of interest in medicinal chemistry. The molecular structure suggests potential applications in drug development, particularly in areas targeting specific biological pathways. Additionally, the compound's stability, reactivity, and solubility in organic solvents are important characteristics that can influence its synthesis and application in research. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C12H14N2O2
InChI:InChI:1S/C12H14N2O2/c1-4-16-12(15)11-9(3)13-10-7-8(2)5-6-14(10)11/h5-7H,4H2,1-3H3
InChI key:CQNUHMHESISBRX-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=C(N=C2N1C=CC(=C2)C)C
Found 4 products.