CymitQuimica logo

CAS 81453-98-7

:

3-Acetyl-1-(phenylsulfonyl)pyrrole

Description:
3-Acetyl-1-(phenylsulfonyl)pyrrole is an organic compound characterized by its pyrrole ring, which is a five-membered aromatic heterocycle containing nitrogen. This compound features an acetyl group and a phenylsulfonyl moiety, contributing to its chemical reactivity and potential applications. The presence of the acetyl group suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. The phenylsulfonyl group enhances the compound's solubility in organic solvents and may influence its electronic properties, making it useful in medicinal chemistry and material science. Additionally, the compound's structure may allow for interactions with biological targets, indicating potential pharmacological activity. Its CAS number, 81453-98-7, facilitates its identification in chemical databases and literature. Overall, 3-Acetyl-1-(phenylsulfonyl)pyrrole is a versatile compound with interesting chemical properties that warrant further investigation for various applications in research and industry.
Formula:C12H11NO3S
InChI:InChI=1/C12H11NO3S/c1-10(14)11-7-8-13(9-11)17(15,16)12-5-3-2-4-6-12/h2-9H,1H3
InChI key:HTMLKRFQINMFRA-UHFFFAOYSA-N
SMILES:CC(=O)c1ccn(c1)S(=O)(=O)c1ccccc1
Found 4 products.