CymitQuimica logo

CAS 81720-18-5

:

Acetic acid, (4-iodophenoxy)-, methyl ester

Description:
Acetic acid, (4-iodophenoxy)-, methyl ester, with the CAS number 81720-18-5, is an organic compound characterized by its ester functional group, which is derived from acetic acid and 4-iodophenol. This compound typically appears as a colorless to pale yellow liquid and is known for its moderate solubility in water, as well as good solubility in organic solvents such as ethanol and ether. The presence of the iodine atom in its structure can impart unique properties, including potential biological activity and reactivity in various chemical reactions. The compound may exhibit characteristics typical of esters, such as pleasant odors and the ability to undergo hydrolysis in the presence of water or acids. Additionally, it may be used in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as it may pose health risks if inhaled or ingested.
Formula:C9H9IO3
InChI:InChI=1S/C9H9IO3/c1-12-9(11)6-13-8-4-2-7(10)3-5-8/h2-5H,6H2,1H3
InChI key:PPKVJSVJTVHTOY-UHFFFAOYSA-N
SMILES:COC(=O)COC1=CC=C(C=C1)I
Found 2 products.