CymitQuimica logo

CAS 81732-48-1

:

C,C′-(5-Acetyl-1,3-phenylene) bis(N,N-dimethylcarbamate)

Description:
C,C′-(5-Acetyl-1,3-phenylene) bis(N,N-dimethylcarbamate) is an organic compound characterized by its bis-carbamate structure, which features two N,N-dimethylcarbamate groups attached to a central 5-acetyl-1,3-phenylene moiety. This compound typically exhibits a moderate to high molecular weight due to its complex structure. It is likely to be a solid at room temperature, with potential applications in various fields such as pharmaceuticals or agrochemicals, owing to the presence of the carbamate functional groups, which are known for their biological activity. The acetyl group contributes to its reactivity and solubility properties, making it potentially useful in synthesis or as an intermediate in chemical reactions. The compound may also display specific optical properties, depending on its molecular arrangement. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact. Further characterization through techniques such as NMR, IR spectroscopy, or mass spectrometry would provide additional insights into its properties and behavior.
Formula:C14H18N2O5
InChI:InChI=1S/C14H18N2O5/c1-9(17)10-6-11(20-13(18)15(2)3)8-12(7-10)21-14(19)16(4)5/h6-8H,1-5H3
InChI key:InChIKey=WTWHLMRXPNOZQX-UHFFFAOYSA-N
SMILES:O(C(N(C)C)=O)C1=CC(OC(N(C)C)=O)=CC(C(C)=O)=C1
Synonyms:
  • 5-Acetylbenzene-1,3-Diyl Bis(Dimethylcarbamate)
  • C,C′-(5-Acetyl-1,3-phenylene) bis(N,N-dimethylcarbamate)
  • Carbamic acid, N,N-dimethyl-, C,C′-(5-acetyl-1,3-phenylene) ester
  • Carbamic acid, dimethyl-, 5-acetyl-1,3-phenylene ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.