CAS 819058-34-9
:2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
Description:
2-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline is an organic compound characterized by the presence of a fluorine atom and a boron-containing dioxaborolane moiety attached to an aniline structure. The compound features a fluorobenzene ring, which enhances its reactivity and potential applications in various chemical reactions, particularly in the field of medicinal chemistry and materials science. The dioxaborolane group contributes to its stability and solubility in organic solvents, making it useful in cross-coupling reactions, such as Suzuki coupling, which is pivotal in the synthesis of complex organic molecules. Additionally, the presence of the tetramethyl substituents provides steric hindrance, influencing the compound's reactivity and interaction with other chemical species. Overall, this compound exemplifies the integration of functional groups that can facilitate diverse chemical transformations while maintaining stability under various conditions. Its unique structure and properties make it a valuable candidate for further research and application in synthetic organic chemistry.
Formula:C12H17BFNO2
InChI:InChI=1/C12H17BFNO2/c1-11(2)12(3,4)17-13(16-11)8-5-6-10(15)9(14)7-8/h5-7H,15H2,1-4H3
SMILES:CC1(C)C(C)(C)OB(c2ccc(c(c2)F)N)O1
Synonyms:- 4-Amino-3-fluorophenylboronicacid,pinacolester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Amino-3-fluorobenzeneboronic acid pinacol ester, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C12H17BFNO2Purity:96%Molecular weight:237.084-Amino-3-Fluorophenylboronic Acid, Pinacol Ester
CAS:Formula:C12H17BFNO2Purity:98%Color and Shape:SolidMolecular weight:237.0783Ref: IN-DA0033WB
100gTo inquire250gTo inquire100mg21.00€250mg25.00€1g31.00€5g84.00€10g126.00€25g210.00€50g506.00€500g2,312.00€1kg3,465.00€4-Amino-3-fluorophenylboronic acid, pinacol ester
CAS:4-Amino-3-fluorophenylboronic acid, pinacol esterFormula:C12H17BFNO2Purity:99%Color and Shape:SolidMolecular weight:237.078284-Amino-3-fluorophenylboronic acid pinacol ester
CAS:Formula:C12H17BFNO2Purity:95%Color and Shape:SolidMolecular weight:237.08



