CymitQuimica logo

CAS 82072-23-9

:

3-(bromomethyl)benzaldehyde

Description:
3-(Bromomethyl)benzaldehyde, with the CAS number 82072-23-9, is an organic compound characterized by the presence of both a bromomethyl group and an aldehyde functional group attached to a benzene ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It has a molecular formula that reflects its structure, containing carbon, hydrogen, and bromine atoms. The bromomethyl group introduces a reactive site that can participate in various chemical reactions, making it useful in organic synthesis, particularly in the preparation of more complex molecules. The aldehyde functional group contributes to its reactivity, allowing it to undergo typical aldehyde reactions, such as oxidation and condensation. Additionally, 3-(bromomethyl)benzaldehyde may exhibit moderate to low solubility in water but is generally soluble in organic solvents. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of bromine and the reactivity of the aldehyde group.
Formula:C8H7BrO
InChI:InChI=1/C8H7BrO/c9-5-7-2-1-3-8(4-7)6-10/h1-4,6H,5H2
InChI key:OEPGAYXSRGROSQ-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)C=O)CBr
Synonyms:
  • Benzaldehyde, 3-(Bromomethyl)-
Found 4 products.