CymitQuimica logo

CAS 821785-75-5

:

6H-Pyrazolo[3,4-c]pyridine-3,6-dicarboxylic acid, 1,4,5,7-tetrahydro-,6-(1,1-dimethylethyl) 3-ethyl ester

Description:
6H-Pyrazolo[3,4-c]pyridine-3,6-dicarboxylic acid, 1,4,5,7-tetrahydro-, 6-(1,1-dimethylethyl) 3-ethyl ester, with CAS number 821785-75-5, is a chemical compound characterized by its complex structure, which includes a pyrazolo-pyridine core. This compound features multiple functional groups, including carboxylic acid and ester moieties, contributing to its potential reactivity and solubility properties. The presence of the tert-butyl group and ethyl ester indicates that it may exhibit hydrophobic characteristics, which can influence its biological activity and interaction with other molecules. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in the development of drugs targeting various biological pathways. The unique arrangement of atoms and functional groups in this compound may also impart specific pharmacokinetic properties, making it a subject of interest in medicinal chemistry. Overall, its structural complexity suggests a diverse range of potential applications, particularly in the fields of drug discovery and development.
Formula:C14H21N3O4
InChI:InChI=1S/C14H21N3O4/c1-5-20-12(18)11-9-6-7-17(8-10(9)15-16-11)13(19)21-14(2,3)4/h5-8H2,1-4H3,(H,15,16)
InChI key:LFTXSSIDXPRQJO-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=NNC2=C1CCN(C2)C(=O)OC(C)(C)C
Found 4 products.