CymitQuimica logo

CAS 821791-58-6

:

ethyl 4-chloro-1-methyl-6-oxo-1,6-dihydropyridine-3-carboxylate

Description:
Ethyl 4-chloro-1-methyl-6-oxo-1,6-dihydropyridine-3-carboxylate is a chemical compound characterized by its pyridine ring structure, which features a chlorine substituent and a carboxylate ester functional group. This compound typically exhibits properties associated with dihydropyridine derivatives, such as potential biological activity, including effects on calcium channels and other pharmacological targets. The presence of the ethyl ester group contributes to its solubility in organic solvents, while the chlorine atom may influence its reactivity and interaction with biological systems. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and cyclization processes. Additionally, due to its specific functional groups, it may exhibit unique spectral characteristics in techniques such as NMR and IR spectroscopy. Overall, ethyl 4-chloro-1-methyl-6-oxo-1,6-dihydropyridine-3-carboxylate is of interest in medicinal chemistry and may serve as a lead compound for further drug development.
Formula:C9H10ClNO3
InChI:InChI=1/C9H10ClNO3/c1-3-14-9(13)6-5-11(2)8(12)4-7(6)10/h4-5H,3H2,1-2H3
InChI key:WGSWOEOJYNQPRP-UHFFFAOYSA-N
SMILES:CCOC(=O)c1cn(C)c(=O)cc1Cl
Found 4 products.