CymitQuimica logo

CAS 821791-59-7

:

4-Chloro-1-methyl-6-oxo-1,6-dihydropyridine-3-carboxylic acid

Description:
4-Chloro-1-methyl-6-oxo-1,6-dihydropyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its pyridine ring structure, which includes a chlorine substituent and a carboxylic acid functional group. This compound features a 1-methyl group and a 6-oxo group, contributing to its unique reactivity and potential biological activity. The presence of the carboxylic acid group suggests that it can participate in acid-base reactions and may exhibit solubility in polar solvents. The chlorine atom introduces additional reactivity, potentially influencing its interaction with biological targets or other chemical species. This compound may be of interest in medicinal chemistry due to its structural features, which could be linked to various pharmacological activities. Its synthesis and characterization would typically involve standard organic chemistry techniques, and it may be utilized in research related to drug development or as an intermediate in the synthesis of more complex molecules. Safety and handling precautions should be observed due to the presence of chlorine and the potential for biological activity.
Formula:C7H6ClNO3
InChI:InChI=1S/C7H6ClNO3/c1-9-3-4(7(11)12)5(8)2-6(9)10/h2-3H,1H3,(H,11,12)
InChI key:InChIKey=FDQXWTFEDBWPHE-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(Cl)=CC(=O)N(C)C1
Synonyms:
  • 3-Pyridinecarboxylic acid, 4-chloro-1,6-dihydro-1-methyl-6-oxo-
  • 4-Chloro-1-methyl-6-oxo-1,6-dihydropyridine-3-carboxylic acid
  • 4-Chloro-1,6-dihydro-1-methyl-6-oxo-3-pyridinecarboxylic acid
Found 1 products.