CymitQuimica logo

CAS 822-82-2

:

4-Isothiazolecarboxylicacid

Description:
4-Isothiazolecarboxylic acid is a heterocyclic compound characterized by the presence of an isothiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. This compound features a carboxylic acid functional group (-COOH) attached to the fourth position of the isothiazole ring, contributing to its acidic properties. It is typically a white to off-white solid that is soluble in water and polar organic solvents. The presence of the carboxylic acid group allows it to participate in various chemical reactions, making it useful in organic synthesis and as a building block for more complex molecules. Additionally, 4-isothiazolecarboxylic acid may exhibit biological activity, which can be explored for potential applications in pharmaceuticals or agrochemicals. Its unique structure and functional groups make it a subject of interest in both synthetic and medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C4H3NO2S
InChI:InChI=1S/C4H3NO2S/c6-4(7)3-1-5-8-2-3/h1-2H,(H,6,7)
InChI key:PCXTYKGTWQCNJI-UHFFFAOYSA-N
SMILES:C1=C(C=NS1)C(=O)O
Synonyms:
  • 4-Carboxyisothiazole
  • 4-Isothiazolecarboxylic acid
Found 7 products.