CAS 824-80-6
:Benzenesulfinic acid, 4-fluoro-, sodium salt (1:1)
Description:
Benzenesulfinic acid, 4-fluoro-, sodium salt (1:1), with the CAS number 824-80-6, is an organosulfur compound characterized by the presence of a sulfinic acid group (-SO2H) attached to a benzene ring that also features a fluorine substituent at the para position. This compound typically appears as a white to off-white solid and is soluble in water due to the ionic nature of the sodium salt. It exhibits properties typical of sulfinic acids, such as being a mild reducing agent and having potential applications in organic synthesis, particularly in the preparation of various derivatives and intermediates. The presence of the fluorine atom can influence the reactivity and stability of the compound, making it useful in specific chemical reactions. Additionally, benzenesulfinic acids are known for their role in the synthesis of dyes, pharmaceuticals, and agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C6H5FO2S·Na
InChI:InChI=1S/C6H5FO2S.Na/c7-5-1-3-6(4-2-5)10(8)9;/h1-4H,(H,8,9);
InChI key:InChIKey=SLINBBSGWNDTQP-UHFFFAOYSA-N
SMILES:S(=O)(O)C1=CC=C(F)C=C1.[Na]
Synonyms:- 4-Fluorobenzenesulfinic Acid
- 4-Fluorobenzenesulfinic acid sodium salt
- Benzenesulfinic acid, 4-fluoro-, sodium salt
- Benzenesulfinic acid, 4-fluoro-, sodium salt (1:1)
- Benzenesulfinic acid, p-fluoro-, sodium salt
- NSC 131873
- P-Fluorobenzenesulfinic acid sodium salt dehydrate
- Sodium 4-Fluorobenzenesulfinate
- Sodium p-fluorobenzenesulfinate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzenesulfinic acid, 4-fluoro-, sodium salt
CAS:Formula:C6H4FNaO2SPurity:95%Color and Shape:SolidMolecular weight:182.1479Sodium 4-Fluorobenzenesulfinate
CAS:Formula:C6H4FNaO2SPurity:>98.0%(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:182.144-Fluorobenzenesulfinic acid sodium salt
CAS:4-Fluorobenzenesulfinic acid sodium saltFormula:C6H4FO2S·NaPurity:95%Color and Shape:Solid-Low MeltMolecular weight:182.147934-Fluorobenzenesulfinic acid sodium salt
CAS:Formula:C6H4FNaO2SPurity:95.0%Color and Shape:Solid, Low Melting SolidMolecular weight:182.144-Flurobenzenesulfinic acid sodium salt
CAS:Controlled ProductApplications 4-Flurobenzenesulfinic acid sodium salt (cas# 824-80-6) is a useful research chemical.
Formula:C6H4FNaO2SColor and Shape:NeatMolecular weight:182.15





