CymitQuimica logo

CAS 824403-26-1

:

5-bromo-2-chloro-1,3-benzothiazole

Description:
5-Bromo-2-chloro-1,3-benzothiazole is a heterocyclic compound characterized by the presence of both bromine and chlorine substituents on a benzothiazole ring system. This compound features a fused benzene and thiazole ring, which contributes to its aromatic properties and potential reactivity. The bromine and chlorine atoms introduce significant electronegativity, influencing the compound's chemical behavior, including its reactivity in nucleophilic substitution reactions. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of halogens can enhance its biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, the compound may exhibit fluorescence properties, which can be useful in various applications, including as a dye or in materials science. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed. Overall, 5-bromo-2-chloro-1,3-benzothiazole is a versatile compound with potential applications in various fields of chemistry and materials science.
Formula:C7H3BrClNS
InChI:InChI=1/C7H3BrClNS/c8-4-1-2-6-5(3-4)10-7(9)11-6/h1-3H
InChI key:CQHUAYKIQCBOKY-UHFFFAOYSA-N
SMILES:c1cc2c(cc1Br)nc(Cl)s2
Synonyms:
  • Benzothiazole, 5-Bromo-2-Chloro-
  • 5-Bromo-2-Chlorobenzo[D]Thiazole
Found 4 products.