CymitQuimica logo

CAS 824943-40-0

:

(2S,5R)-5-Hydroxypipecolic acid hydrochloride

Description:
(2S,5R)-5-Hydroxypipecolic acid hydrochloride is a chemical compound characterized by its specific stereochemistry, indicated by the (2S,5R) configuration. This compound is a derivative of pipecolic acid, which is a cyclic amino acid. The presence of a hydroxyl group at the 5-position contributes to its solubility and reactivity, making it of interest in various biochemical applications. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, facilitating its use in laboratory settings. The compound may exhibit biological activity, potentially influencing metabolic pathways or serving as a building block in the synthesis of pharmaceuticals. Its structural features allow for interactions with biological macromolecules, which can be pivotal in drug design and development. Overall, (2S,5R)-5-Hydroxypipecolic acid hydrochloride is notable for its unique stereochemistry and potential applications in medicinal chemistry and biochemistry.
Formula:C6H11NO3HCl
InChI:InChI=1S/C6H11NO3.ClH/c8-4-1-2-5(6(9)10)7-3-4;/h4-5,7-8H,1-3H2,(H,9,10);1H/t4-,5+;/m1./s1
InChI key:ZWHYCCWEJZJLHW-JBUOLDKXSA-N
SMILES:C1C[C@H](NC[C@@H]1O)C(=O)O.Cl
Found 4 products.