CAS 825-22-9

2-amino-3-fluorobenzoic acid

Description:

2-Amino-3-fluorobenzoic acid, with the CAS number 825-22-9, is an aromatic amino acid derivative characterized by the presence of both an amino group (-NH2) and a carboxylic acid group (-COOH) attached to a benzene ring that also features a fluorine atom at the meta position relative to the amino group. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. The presence of the amino and carboxylic acid groups allows it to participate in various chemical reactions, including acid-base reactions and nucleophilic substitutions. Its fluorine substituent can influence the compound's reactivity and biological activity, making it of interest in pharmaceutical and materials science research. Additionally, 2-amino-3-fluorobenzoic acid can serve as a building block in the synthesis of more complex molecules and may exhibit specific biological activities, which can be explored in medicinal chemistry.

Formula: C₇H₆FNO₂

InChI: InChI=1S/C7H6FNO2/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,9H2,(H,10,11)

InChI key: KUHAYJJXXGBYBW-UHFFFAOYSA-N

SMILES: C1=CC(=C(C(=C1)F)N)C(=O)O

2-Amino-3-fluorobenzoic Acid

CAS: 825-22-9

Formula: C₇H₆FNO₂

Purity: >98.0%(HPLC)(T)

Color and Shape: White to Light yellow to Light orange powder to crystal

Molecular weight: 155.13

Ref: 3B-F0570

2-Amino-3-fluorobenzoic acid

CAS: 825-22-9

Formula: C₇H₆FNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 155.1264

Ref: IN-DA003GDK

2-Amino-3-fluorobenzoic acid

CAS: 825-22-9

2-Amino-3-fluorobenzoic acid

Formula: C₇H₆FNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 155.12644

Ref: 54-PC1089

2-Amino-3-fluorobenzoic acid

CAS: 825-22-9

2-Amino-3-fluorobenzoic acid is a covid-19 pandemic anti-infective agent that has been shown to modulate the nicotinic acetylcholine receptor. It has been shown to be effective in preventing the spread of influenza A (H1N1) and other flu strains, as well as the related H5N1 avian flu. 2-Amino-3-fluorobenzoic acid is an organofluorine compound with a five membered ring and fluorine atom in the para position. 2-Amino-3-fluorobenzoic acid binds to the ligand binding site of the acetylcholine receptor, which is found on nerve cells. The drug competitively inhibits acetylcholine's binding to this site, preventing activation of the receptor and blocking transmission of nerve impulses across synapses. This prevents muscle contraction, leading to paralysis and death from respiratory

Formula: C₇H₆FNO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 155.13 g/mol

Ref: 3D-FA64176

2-Amino-3-fluoro-benzoic acid

CAS: 825-22-9

Formula: C₇H₆FNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 155.128

Ref: 10-F040187

2-Amino-3-fluorobenzoic acid

CAS: 825-22-9

2-Amino-3-fluorobenzoic acid

Formula: C₇H₆FNO₂

Purity: 98%

Molecular weight: 155.13

Ref: IN-DG10462