CymitQuimica logo

CAS 82500-22-9

:

Piperazine, 1-(cyclopentylmethyl)-

Description:
Piperazine, 1-(cyclopentylmethyl)- is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine featuring two nitrogen atoms. The compound is distinguished by the presence of a cyclopentylmethyl group attached to one of the nitrogen atoms in the piperazine ring. This structural modification can influence its pharmacological properties and interactions with biological systems. Typically, piperazine derivatives are known for their potential applications in medicinal chemistry, particularly as anxiolytics, antidepressants, and in the treatment of various neurological disorders. The compound may exhibit moderate solubility in polar solvents, and its behavior in biological systems can be influenced by the cyclopentylmethyl substituent, which may affect lipophilicity and receptor binding. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacokinetic and pharmacodynamic profiles.
Formula:C10H20N2
InChI:InChI=1S/C10H20N2/c1-2-4-10(3-1)9-12-7-5-11-6-8-12/h10-11H,1-9H2
InChI key:HDSJFNAPZZCQAT-UHFFFAOYSA-N
SMILES:C1CCC(C1)CN2CCNCC2
Found 4 products.