CymitQuimica logo

CAS 82504-70-9

:

1,3,5-Triazine-2,4,6-triamine, N,N',N''-tris(3-methylphenyl)-

Description:
1,3,5-Triazine-2,4,6-triamine, N,N',N''-tris(3-methylphenyl)-, commonly known by its CAS number 82504-70-9, is a chemical compound characterized by its triazine core structure, which consists of a six-membered ring containing three nitrogen atoms and three carbon atoms. This compound features three 3-methylphenyl substituents attached to the triazine nitrogen atoms, enhancing its potential for various applications, particularly in materials science and organic synthesis. The presence of the methyl groups on the phenyl rings contributes to its hydrophobic properties and may influence its solubility and reactivity. Additionally, the triazine moiety is known for its stability and ability to participate in various chemical reactions, making this compound of interest in the development of agrochemicals, pharmaceuticals, and polymeric materials. Its unique structure may also impart specific electronic and optical properties, which can be exploited in advanced materials and nanotechnology applications. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C24H24N6
InChI:InChI=1S/C24H24N6/c1-16-7-4-10-19(13-16)25-22-28-23(26-20-11-5-8-17(2)14-20)30-24(29-22)27-21-12-6-9-18(3)15-21/h4-15H,1-3H3,(H3,25,26,27,28,29,30)
InChI key:XMOZWTZDMACVMS-UHFFFAOYSA-N
SMILES:CC1=CC(=CC=C1)NC2=NC(=NC(=N2)NC3=CC=CC(=C3)C)NC4=CC=CC(=C4)C
Found 5 products.