CAS 82594-19-2

(7,7-dimethyl-2,3-dioxobicyclo[2.2.1]hept-1-yl)methanesulfonyl chloride

Description:

(7,7-Dimethyl-2,3-dioxobicyclo[2.2.1]hept-1-yl)methanesulfonyl chloride, with the CAS number 82594-19-2, is a chemical compound characterized by its bicyclic structure and the presence of a sulfonyl chloride functional group. This compound features a bicyclo[2.2.1]heptane framework, which contributes to its rigidity and unique reactivity. The two ketone groups (dioxo) enhance its electrophilic character, making it a potential intermediate in organic synthesis, particularly in the formation of sulfonamides or other derivatives. The methanesulfonyl chloride moiety is known for its ability to act as a sulfonating agent, facilitating the introduction of sulfonyl groups into various substrates. This compound is typically handled with care due to its reactivity and potential hazards associated with the sulfonyl chloride group, which can release hydrochloric acid upon reaction. Overall, its distinctive structural features and functional groups make it a valuable compound in synthetic organic chemistry.

Formula: C₁₀H₁₃ClO₄S

InChI: InChI=1/C10H13ClO4S/c1-9(2)6-3-4-10(9,5-16(11,14)15)8(13)7(6)12/h6H,3-5H2,1-2H3

SMILES: CC1(C)C2CCC1(CS(=O)(=O)Cl)C(=O)C2=O

Camphorquinone-10-sulfonyl Chloride

Controlled Product

CAS: 82594-19-2

Formula: C₁₀H₁₃ClO₄S

Color and Shape: Neat

Molecular weight: 264.73

Ref: TR-C174990

Camphorquinone-10-sulfonyl chloride

CAS: 82594-19-2

Camphorquinone-10-sulfonyl chloride is a reagent that is used to inhibit trypsin by binding to the active site of the enzyme. By blocking this site, it prevents the breakdown of proteins into peptides and polypeptides. Camphorquinone-10-sulfonyl chloride is soluble in organic solvents and can be used as an analytical reagent for protein sequencing. It has also been shown to have activity against soybean trypsin. The chemical structure includes a camphor group that is attached to a sulfonyl chloride, which is attached to a benzene ring. This compound is crystalline with hydroxylamine groups on both sides of the camphor group.

Formula: C₁₀H₁₃ClO₄S

Purity: Min. 95%

Color and Shape: Yellow Powder

Molecular weight: 264.73 g/mol

Ref: 3D-FC19646