CymitQuimica logo

CAS 827-58-7

:

1,3,4-Oxadiazole, 2-(4-methylphenyl)-

Description:
1,3,4-Oxadiazole, 2-(4-methylphenyl)-, with the CAS number 827-58-7, is a heterocyclic organic compound characterized by a five-membered ring containing two nitrogen atoms and three carbon atoms, specifically in the oxadiazole structure. This compound features a para-methylphenyl group attached to the oxadiazole ring, which influences its chemical properties and reactivity. Typically, oxadiazoles exhibit interesting biological activities, including antimicrobial and anti-inflammatory properties, making them of interest in pharmaceutical research. The presence of the methyl group on the phenyl ring can enhance lipophilicity, potentially affecting the compound's solubility and bioavailability. In terms of physical properties, 1,3,4-oxadiazoles generally have moderate melting points and can be synthesized through various methods, including cyclization reactions. The compound's stability and reactivity can vary based on substituents and environmental conditions, making it a subject of study in both organic synthesis and medicinal chemistry.
Formula:C9H8N2O
InChI:InChI=1S/C9H8N2O/c1-7-2-4-8(5-3-7)9-11-10-6-12-9/h2-6H,1H3
InChI key:ZSAGZTDFXXUAOE-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)C2=NN=CO2
Synonyms:
  • 2-P-Tolyl-1,3,4-Oxadiazole
Found 3 products.