CymitQuimica logo

CAS 82717-40-6

:

1H-Indole-2-carboxylicacid, octahydro-

Description:
1H-Indole-2-carboxylic acid, octahydro- (CAS 82717-40-6) is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific derivative features a carboxylic acid functional group at the 2-position of the indole ring, contributing to its acidic properties. The "octahydro-" prefix indicates that the compound has undergone hydrogenation, resulting in a saturated structure that may influence its reactivity and solubility. Typically, compounds of this nature are of interest in medicinal chemistry due to their potential biological activities, including antimicrobial and anti-inflammatory properties. The presence of the carboxylic acid group enhances its ability to participate in hydrogen bonding, which can affect its interactions with biological targets. Additionally, the compound's molecular weight, melting point, and solubility characteristics would be relevant for applications in pharmaceuticals or organic synthesis, although specific values would need to be referenced from experimental data.
Formula:C9H15NO2
InChI:InChI=1S/C9H15NO2/c11-9(12)8-5-6-3-1-2-4-7(6)10-8/h6-8,10H,1-5H2,(H,11,12)
InChI key:CQYBNXGHMBNGCG-UHFFFAOYSA-N
SMILES:C1CCC2C(C1)CC(N2)C(=O)O
Synonyms:
  • 1H-Indole-2-carboxylicacid,octahydro-(9CI)
Found 4 products.