CAS 82749-70-0
:4-[(2-butyl-6,7-dichloro-2-cyclopentyl-1-oxo-2,3-dihydro-1H-inden-5-yl)oxy]butanoic acid
Description:
4-[(2-butyl-6,7-dichloro-2-cyclopentyl-1-oxo-2,3-dihydro-1H-inden-5-yl)oxy]butanoic acid, with the CAS number 82749-70-0, is a chemical compound that belongs to the class of organic acids. It features a complex structure characterized by a butanoic acid moiety linked to a substituted indene derivative. The presence of chlorine atoms and a cyclopentyl group contributes to its unique chemical properties and potential biological activity. This compound may exhibit specific interactions due to its functional groups, which can influence its solubility, reactivity, and potential applications in pharmaceuticals or agrochemicals. The butyl group enhances hydrophobic characteristics, while the dichloro substitution may impart specific electronic properties. As with many organic compounds, its stability, reactivity, and potential toxicity would depend on environmental conditions and the presence of other substances. Further studies would be necessary to fully elucidate its characteristics and potential uses in various fields.
Formula:C22H28Cl2O4
InChI:InChI=1/C22H28Cl2O4/c1-2-3-10-22(15-7-4-5-8-15)13-14-12-16(28-11-6-9-17(25)26)19(23)20(24)18(14)21(22)27/h12,15H,2-11,13H2,1H3,(H,25,26)
SMILES:CCCCC1(Cc2cc(c(c(c2C1=O)Cl)Cl)OCCCC(=O)O)C1CCCC1
Synonyms:- Butanoic acid, 4-[(2-butyl-6,7-dichloro-2-cyclopentyl-2,3-dihydro-1-oxo-1H-inden-5-yl)oxy]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
DCPIB
CAS:DCPIB, a known specific and potent inhibitor of volume-regulated anion channels (VRAC),DCPIB displayed superior selectivity toward TRESK with an IC50 of 0.14 μMFormula:C22H28Cl2O4Purity:99.79% - 99.87%Color and Shape:SolidMolecular weight:427.36Ref: TM-T10979
2mg39.00€5mg57.00€10mg87.00€25mg177.00€50mg301.00€100mg485.00€200mg690.00€1mL*10mM (DMSO)63.00€DCPIB
CAS:Controlled ProductDcpib is a small molecule that is structurally related to the neurotransmitter dopamine and has been shown to have neuroprotective effects in vitro. Dcpib increases neuronal survival following oxidative stress and blocks the cellular changes associated with neuronal death, such as mitochondrial membrane potential collapse and channel opening. It also prevents the release of glutamate, which leads to neuronal death by activating NMDA receptors. Dcpib has been shown to inhibit ATP binding cassette transporter A1 (ABCA1), which is a drug target for cholesterol-lowering drugs. The pharmacological activity of dcpib may be due to its ability to inhibit ABCA1 function and increase the level of cytosolic Ca2+.
Formula:C22H28Cl2O4Purity:Min. 95%Color and Shape:White To Yellow To Beige SolidMolecular weight:427.36 g/mol




