CymitQuimica logo

CAS 82749-70-0

:

4-[(2-butyl-6,7-dichloro-2-cyclopentyl-1-oxo-2,3-dihydro-1H-inden-5-yl)oxy]butanoic acid

Description:
4-[(2-butyl-6,7-dichloro-2-cyclopentyl-1-oxo-2,3-dihydro-1H-inden-5-yl)oxy]butanoic acid, with the CAS number 82749-70-0, is a chemical compound that belongs to the class of organic acids. It features a complex structure characterized by a butanoic acid moiety linked to a substituted indene derivative. The presence of chlorine atoms and a cyclopentyl group contributes to its unique chemical properties and potential biological activity. This compound may exhibit specific interactions due to its functional groups, which can influence its solubility, reactivity, and potential applications in pharmaceuticals or agrochemicals. The butyl group enhances hydrophobic characteristics, while the dichloro substitution may impart specific electronic properties. As with many organic compounds, its stability, reactivity, and potential toxicity would depend on environmental conditions and the presence of other substances. Further studies would be necessary to fully elucidate its characteristics and potential uses in various fields.
Formula:C22H28Cl2O4
InChI:InChI=1/C22H28Cl2O4/c1-2-3-10-22(15-7-4-5-8-15)13-14-12-16(28-11-6-9-17(25)26)19(23)20(24)18(14)21(22)27/h12,15H,2-11,13H2,1H3,(H,25,26)
InChI key:KHKGTPJPBOQECW-UHFFFAOYSA-N
SMILES:CCCCC1(Cc2cc(c(c(c2C1=O)Cl)Cl)OCCCC(=O)O)C1CCCC1
Synonyms:
  • Butanoic acid, 4-[(2-butyl-6,7-dichloro-2-cyclopentyl-2,3-dihydro-1-oxo-1H-inden-5-yl)oxy]-
Found 5 products.