CAS 82749-70-0

4-[(2-butyl-6,7-dichloro-2-cyclopentyl-1-oxo-2,3-dihydro-1H-inden-5-yl)oxy]butanoic acid

Description:

4-[(2-butyl-6,7-dichloro-2-cyclopentyl-1-oxo-2,3-dihydro-1H-inden-5-yl)oxy]butanoic acid, with the CAS number 82749-70-0, is a chemical compound that belongs to the class of organic acids. It features a complex structure characterized by a butanoic acid moiety linked to a substituted indene derivative. The presence of chlorine atoms and a cyclopentyl group contributes to its unique chemical properties and potential biological activity. This compound may exhibit specific interactions due to its functional groups, which can influence its solubility, reactivity, and potential applications in pharmaceuticals or agrochemicals. The butyl group enhances hydrophobic characteristics, while the dichloro substitution may impart specific electronic properties. As with many organic compounds, its stability, reactivity, and potential toxicity would depend on environmental conditions and the presence of other substances. Further studies would be necessary to fully elucidate its characteristics and potential uses in various fields.

Formula: C₂₂H₂₈Cl₂O₄

InChI: InChI=1/C22H28Cl2O4/c1-2-3-10-22(15-7-4-5-8-15)13-14-12-16(28-11-6-9-17(25)26)19(23)20(24)18(14)21(22)27/h12,15H,2-11,13H2,1H3,(H,25,26)

InChI key: KHKGTPJPBOQECW-UHFFFAOYSA-N

SMILES: CCCCC1(Cc2cc(c(c(c2C1=O)Cl)Cl)OCCCC(=O)O)C1CCCC1

Synonyms:

• Butanoic acid, 4-[(2-butyl-6,7-dichloro-2-cyclopentyl-2,3-dihydro-1-oxo-1H-inden-5-yl)oxy]-

DCPIB

CAS: 82749-70-0

DCPIB, a known specific and potent inhibitor of volume-regulated anion channels (VRAC),DCPIB displayed superior selectivity toward TRESK with an IC50 of 0.14 μM

Formula: C₂₂H₂₈Cl₂O₄

Purity: 99.77% - 99.79%

Color and Shape: Solid

Molecular weight: 427.36

Ref: TM-T10979

DCPIB

CAS: 82749-70-0

Formula: C₂₂H₂₈Cl₂O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 427.3613

Ref: IN-DA008IWA

DCPIB

CAS: 82749-70-0

Purity: 99%

Color and Shape: Solid

Molecular weight: 427.3599854

Ref: 10-F863203

DCPIB

Controlled Product

CAS: 82749-70-0

Formula: C₂₂H₂₈Cl₂O₄

Color and Shape: Neat

Molecular weight: 427.36

Ref: TR-D195150