CAS 82772-93-8

2,6-Dichloro-4-methoxybenzaldehyde

Description:

2,6-Dichloro-4-methoxybenzaldehyde is an organic compound characterized by its aromatic structure, featuring a benzaldehyde functional group. It contains two chlorine atoms and a methoxy group (-OCH3) attached to the benzene ring, specifically at the 2 and 6 positions relative to the aldehyde group at the 1 position. This compound is typically a pale yellow to light brown solid at room temperature and is known for its distinct aromatic odor. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to its hydrophobic nature. The presence of chlorine atoms enhances its reactivity, making it useful in various chemical syntheses, particularly in the production of pharmaceuticals and agrochemicals. Additionally, the methoxy group can influence the compound's electronic properties and reactivity, making it a valuable intermediate in organic synthesis. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.

Formula: C8H6Cl2O2

InChI: InChI=1S/C8H6Cl2O2/c1-12-5-2-7(9)6(4-11)8(10)3-5/h2-4H,1H3

InChI key: VOYUCTPCAWSYTF-UHFFFAOYSA-N

SMILES: COC1=CC(=C(C(=C1)Cl)C=O)Cl

2,6-dichloro-4-methoxybenzaldehyde

CAS: 82772-93-8

Formula: C₈H₆Cl₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 205.0380

Ref: IN-DA00G5MY

2,6-Dichloro-4-methoxybenzaldehyde

CAS: 82772-93-8

2,6-Dichloro-4-methoxybenzaldehyde

Formula: C₈H₆Cl₂O₂

Purity: 95%

Molecular weight: 205.04

Ref: IN-DG254340

2,6-Dichloro-4-methoxybenzaldehyde

CAS: 82772-93-8

2,6-Dichloro-4-methoxybenzaldehyde

Formula: C₈H₆Cl₂O₂

Purity: 95%

Color and Shape: Off-white Solid

Molecular weight: 205.03804

Ref: 54-OR310630

2,6-Dichloro-4-methoxybenzaldehyde

CAS: 82772-93-8

Formula: C₈H₆Cl₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 205.03

Ref: 10-F459343

2,6-Dichloro-4-methoxybenzaldehyde

CAS: 82772-93-8

2,6-Dichloro-4-methoxybenzaldehyde is a chemical compound that has been shown to inhibit the development of breast cancer in animals. It binds to the estrogen receptor, preventing it from binding to DNA and initiating cell division. This leads to the suppression of cellular proliferation, which is an essential process in tumor formation. 2,6-Dichloro-4-methoxybenzaldehyde has also been shown to bind to estradiol and prevent its binding to the estrogen receptor. This prevents estradiol from initiating cell proliferation and inhibits tumor growth. 2,6-Dichloro-4-methoxybenzaldehyde has also been shown to be an antiestrogenic agent by inhibiting the production of endogenous estrogens in cells.

Formula: C₈H₆Cl₂O₂

Purity: Min. 95%

Molecular weight: 205.04 g/mol

Ref: 3D-HDA77293