CAS 828-01-3

(±)-3-Phenyllactic acid

Description:

(±)-3-Phenyllactic acid, with the CAS number 828-01-3, is an organic compound that belongs to the class of alpha-hydroxy acids. It is characterized by the presence of both a carboxylic acid and a hydroxyl group on the same carbon chain, specifically at the third carbon position relative to the carboxylic acid group. This compound exists as a racemic mixture, containing both enantiomers, which means it has two mirror-image forms that can exhibit different biological activities. (±)-3-Phenyllactic acid is typically a white to off-white crystalline solid and is soluble in water, making it useful in various applications, including pharmaceuticals and cosmetics. It is known for its potential antimicrobial properties and is studied for its role in metabolic processes. Additionally, it can be involved in the synthesis of other chemical compounds and may serve as a chiral building block in organic synthesis. Its stability and reactivity can vary depending on environmental conditions such as pH and temperature.

Formula:C₉H₁₀O₃

InChI:InChI=1S/C9H10O3/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12)

InChI key:InChIKey=VOXXWSYKYCBWHO-UHFFFAOYSA-N

SMILES:C(C(C(O)=O)O)C1=CC=CC=C1

Synonyms:

(+/-)-2-Hydroxy-3-phenylpropionic acid
(+/-)-3-Phenyllactic acid
(RS)-3-Phenyllactic acid
(±)-2-Hydroxy-3-phenylpropanoic acid
(±)-β-Phenyllactic acid
3,3',3'',3'''-[3,8-Bis(Carboxymethyl)-13,17-Dimethylporphyrin-2,7,12,18-Tetrayl]Tetrapropanoic Acid
3-Phenyl-2-hydroxypropanoic acid
DL-2-Hydroxy-3-phenylpropionic acid
DL-3-Phenyllactic acid
DL-β-Phenyllactic acid
Ba 2653
Benzenepropanoic acid, α-hydroxy-
DL-3-Phenyllactic acid, (DL-2-Hydroxy-3-phenylpropionic acid)
DL-?-Phenyllactic acid ()-2-Hydroxy-3-phenylpropionic acid
Dl-Beta-Phenyllactic Acid
Lactic acid, 3-phenyl-, DL-
Lactic acid, β-phenyl-
NSC 2627
dl-Phenyllactic acid
α-Hydroxy-β-phenylpropionic acid
α-Hydroxybenzenepropanoic acid
α-Hydroxyphenylpropanoic acid
See more synonyms