CAS 828-27-3
:4-(Trifluoromethoxy)phenol
Description:
4-(Trifluoromethoxy)phenol, with the CAS number 828-27-3, is an organic compound characterized by the presence of a phenolic hydroxyl group (-OH) and a trifluoromethoxy group (-O-CF3) attached to the para position of the phenol ring. This compound is typically a white to off-white solid at room temperature and is known for its distinctive properties due to the electronegative trifluoromethoxy substituent, which can influence its reactivity and solubility. The trifluoromethoxy group enhances the compound's lipophilicity and can affect its biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Additionally, 4-(Trifluoromethoxy)phenol exhibits moderate to high stability under standard conditions, but it may undergo reactions typical of phenolic compounds, such as oxidation or substitution. Its unique structure allows for potential applications in the synthesis of more complex molecules and in the development of materials with specific electronic or chemical properties.
Formula:C7H5F3O2
InChI:InChI=1S/C7H5F3O2/c8-7(9,10)12-6-3-1-5(11)2-4-6/h1-4,11H
InChI key:InChIKey=WDRJNKMAZMEYOF-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=CC=C(O)C=C1
Synonyms:- 2-Fluoro-1,4-Dimethoxybenzene
- 4-(Trifluormethoxy)benzolol
- 4-Trifluoromethoxyphenol
- Phenol, 4-(trifluoromethoxy)-
- Phenol, p-(trifluoromethoxy)-
- Qr Doxfff
- p-Trifluoromethoxy phenol
- 4-(trifluoromethoxy)phenole
- 4-(Trifluoromethoxy)phenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-(Trifluoromethoxy)phenol
CAS:Formula:C7H5F3O2Purity:>95.0%(GC)Color and Shape:Light yellow to Yellow to Orange clear liquidMolecular weight:178.114-(Trifluoromethoxy)phenol
CAS:4-(Trifluoromethoxy)phenolFormula:C7H5F3O2Purity:98%Color and Shape:LiquidMolecular weight:178.10864-(Trifluoromethoxy)phenol
CAS:Formula:C7H5F3O2Purity:98%Color and Shape:LiquidMolecular weight:178.10864-(Trifluoromethoxy)phenol
CAS:Formula:C7H5F3O2Purity:98.0%Color and Shape:LiquidMolecular weight:178.114-(Trifluoromethoxy)phenol
CAS:4-(Trifluoromethoxy)phenol is an anti-tuberculosis drug. It is a diode that has been shown to have pharmacokinetic properties in rats and mice. 4-(Trifluoromethoxy)phenol has been shown to act as a prodrug, which is activated by conversion to the active form. This active form inhibits the growth of Mycobacterium tuberculosis by binding to the 50S ribosomal subunit and preventing bacterial transcription and replication. The molecular structure of 4-(trifluoromethoxy)phenol is similar to phenoxypropanoid compounds, such as biphenyl, which may be responsible for its anti-tuberculosis effects. 4-(Trifluoromethoxy)phenol also binds DNA at specific sites with high affinity and specificity, inhibiting gene expression and RNA synthesis.Formula:C7H5F3O2Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:178.11 g/mol4-(Trifluoromethoxy)phenol
CAS:Controlled ProductApplications 4-(Trifluoromethoxy)phenol is used as a reactant in the preparation of 1-aryloxyethyl piperazine derivatives as Kv1.5 potassium channel inhibitors.
References Guo, X., et. al.: Eur. J. Med. Chem., 81 (2014)Formula:C7H5F3O2Color and Shape:NeatMolecular weight:178.11





