CAS 828-81-9

1,3,4-Thiadiazol-2-amine, 5-(2-chlorophenyl)-

Description:

1,3,4-Thiadiazol-2-amine, 5-(2-chlorophenyl)-, with the CAS number 828-81-9, is a heterocyclic compound featuring a thiadiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. This compound exhibits characteristics typical of thiadiazoles, including potential biological activity, making it of interest in pharmaceutical research. The presence of the 2-chlorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. The amine functional group contributes to its reactivity, allowing for potential derivatization and modification. This compound may exhibit properties such as antimicrobial, antifungal, or anti-inflammatory activities, although specific biological effects would depend on the context of its use and the presence of other substituents. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. Overall, 1,3,4-Thiadiazol-2-amine, 5-(2-chlorophenyl)- is a compound of interest in medicinal chemistry and material science due to its unique structural features and potential applications.

Formula: C₈H₆ClN₃S

InChI: InChI=1S/C8H6ClN3S/c9-6-4-2-1-3-5(6)7-11-12-8(10)13-7/h1-4H,(H2,10,12)

InChI key: JKSGNHRIXMYPIO-UHFFFAOYSA-N

SMILES: C1=CC=C(C(=C1)C2=NN=C(S2)N)Cl

5-(2-Chlorophenyl)-1,3,4-Thiadiazol-2-Amine

CAS: 828-81-9

5-(2-Chlorophenyl)-1,3,4-Thiadiazol-2-Amine

Formula: C₈H₆ClN₃S

Purity: 0.95

Molecular weight: 211.67

Ref: 54-OR1030001

5-(2-Chlorophenyl)-1,3,4-thiadiazol-2-amine

CAS: 828-81-9

Formula: C₈H₆ClN₃S

Purity: 95%

Color and Shape: Solid

Molecular weight: 211.6713

Ref: IN-DA004WFG

5-(2-Chlorophenyl)-1,3,4-thiadiazol-2-amine

CAS: 828-81-9

5-(2-Chlorophenyl)-1,3,4-thiadiazol-2-amine

Formula: C₈H₆ClN₃S

Purity: 95%

Molecular weight: 211.67

Ref: IN-DG183220

5-(2-chlorophenyl)-1,3,4-thiadiazol-2-amine

CAS: 828-81-9

Formula: C₈H₆ClN₃S

Purity: 97%

Color and Shape: Solid

Molecular weight: 211.67

Ref: 10-F354270

5-(2-Chloro-phenyl)-[1,3,4]thiadiazol-2-ylamine

CAS: 828-81-9

5-(2-Chloro-phenyl)-[1,3,4]thiadiazol-2-ylamine is a chemical compound that is a member of the heterocyclic family of compounds. It has been shown to be an excellent catalyst for the condensation reaction between amines and aldehydes or ketones. 5-(2-Chloro-phenyl)-[1,3,4]thiadiazol-2-ylamine has also been found to be an efficient catalyst for the hydrogenation of carboxylic acids. The elemental analysis of this product shows that it is composed of carbon (C), chlorine (Cl), hydrogen (H), and nitrogen (N).

Formula: C₈H₆ClN₃S

Purity: Min. 95%

Molecular weight: 211.67 g/mol

Ref: 3D-AAA82881